missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Titriplex™ II, For Analysis, Ethylenedinitrilotetraacetic acid, ACS, MilliporeSigma™
Supplier: Technidata 1084170250
Spécifications
| Ethylenedinitrilotetraacetic Acid | |
| White | |
| Fine Crystals or Crystalline Powder | |
| 99.4 - 100.6% | |
| MFCD00003541 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid | |
| 6049 | |
| ACS/Reagent Ph. Eur. | |
| Plastic bottle | |
| 220°C (Decomposition) |
| 60-00-4 | |
| 2.5 | |
| 250 g | |
| C10H16N2O8 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
| 292.24 | |
| CHEBI:42191 | |
| ≥200°C | |
| ≤0.013 hPa (20°C) | |
| 0.86g/cm3 (20°C); Bulk Density: 600 kg/m3 |
Identifiants chimiques
| 60-00-4 | |
| 292.24 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 6049 | |
| 2-({2-[bis(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetic acid |
| C10H16N2O8 | |
| MFCD00003541 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| CHEBI:42191 | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
Sécurité et manipulation
P305 + P351 + P338: IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
H319: Causes serious eye irritation.
missing translation for 'einecsNumber' : 200-449-4
missing translation for 'rtecsNumber' : AH4025000
missing translation for 'storageNote' : Storage temperature: No restrictions.