missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Thymolphthalein, pure, indicator
CAS: 125-20-2 | C28H30O4 | 430.544 g/mol
Supplier: Thermo Scientific Chemicals 151460500
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorSpecifications
| Thymolphthalein | |
| Indicator | |
| C28H30O4 | |
| 18, I, 381 | |
| TP | |
| LDKDGDIWEUUXSH-UHFFFAOYSA-N | |
| CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O | |
| 430.544 | |
| 1% max. | |
| Pure | |
| from pH 8.8 (colorless) to pH 10.5 (blue) | |
| 50 g |
| 251.0°C to 253.0°C | |
| 125-20-2 | |
| MFCD00005909 | |
| 15, 9556 | |
| Solubility in water: insoluble. Other solubilities: soluble in dilute alkali and acids, soluble in alcohol and acetone | |
| Authentic | |
| 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one | |
| 31316 | |
| 430.53 | |
| Glass bottle | |
| White | |
| Fine Crystalline Powder |
Chemical Identifiers
| 125-20-2 | |
| 430.544 | |
| LDKDGDIWEUUXSH-UHFFFAOYSA-N | |
| 31316 | |
| CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O |
| C28H30O4 | |
| MFCD00005909 | |
| TP | |
| 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one |
RUO – Research Use Only