missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Thymolphthalein, pure, indicator
CAS: 125-20-2 | C28H30O4 | 430.544 g/mol
$72.93 - $932.87
Chemical Identifiers
| CAS | 125-20-2 |
|---|---|
| Molecular Formula | C28H30O4 |
| Molecular Weight (g/mol) | 430.544 |
| MDL Number | MFCD00005909 |
| InChI Key | LDKDGDIWEUUXSH-UHFFFAOYSA-N |
| Synonym | TP |
| PubChem CID | 31316 |
| IUPAC Name | 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one |
| SMILES | CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC151460100
|
Thermo Scientific Chemicals
151460100 |
10 g | Glass bottle |
Each for $72.93
|
|
||||
|
AC151460500
|
Thermo Scientific Chemicals
151460500 |
50 g | Glass bottle |
Each for $217.10
|
|
||||
|
AC151462500
|
Thermo Scientific Chemicals
151462500 |
250 g | Glass bottle |
Each for $932.87
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
IndicatorChemical Identifiers
| 125-20-2 | |
| 430.544 | |
| LDKDGDIWEUUXSH-UHFFFAOYSA-N | |
| 31316 | |
| CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O |
| C28H30O4 | |
| MFCD00005909 | |
| TP | |
| 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one |
Specifications
| 251.0°C to 253.0°C | |
| C28H30O4 | |
| 18, I, 381 | |
| TP | |
| LDKDGDIWEUUXSH-UHFFFAOYSA-N | |
| CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O | |
| 430.544 | |
| 1% max. | |
| Pure | |
| from pH 8.8 (colorless) to pH 10.5 (blue) | |
| 10 g | |
| Thymolphthalein, Indicator |
| 125-20-2 | |
| MFCD00005909 | |
| 15, 9556 | |
| Solubility in water: insoluble. Other solubilities: soluble in dilute alkali and acids, soluble in alcohol and acetone | |
| Authentic | |
| 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one | |
| 31316 | |
| 430.53 | |
| Glass bottle | |
| White | |
| Fine Crystalline Powder |
RUO – Research Use Only