missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thymolphthalein (0.1% in ca. 95% Ethanol) [for pH Determination and Titration], TCI America™
$62.66 - $170.87
Chemical Identifiers
| CAS | 125-20-2 |
|---|---|
| Molecular Formula | C28H30O4 |
| Molecular Weight (g/mol) | 430.544 |
| MDL Number | MFCD00005909 |
| InChI Key | LDKDGDIWEUUXSH-UHFFFAOYSA-N |
| Synonym | thymolphthalein, thymophthalein, unii-yg5i28wsqp, yg5i28wsqp, phenolphthalein, 5',5-diisopropyl-2',2-dimethyl, 3,3-bis 4-hydroxy-5-isopropyl-2-methylphenyl-2-benzofuran-1 3h-one, 1 3h-isobenzofuranone, 3,3-bis 4-hydroxy-2-methyl-5-1-methylethyl phenyl, 5',5-diisopropyl-2',2-dimethylphenolphthalein, 3,3-bis 4-hydroxy-2-methyl-5-propan-2-ylphenyl-2-benzofuran-1-one |
| PubChem CID | 31316 |
| IUPAC Name | 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one |
| SMILES | CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
T0130100ML
|
TCI America
T0130100ML |
100 mL |
Each for $62.66
|
|
|||||
|
T0130500ML
|
TCI America
T0130500ML |
500 mL |
Each for $170.87
|
|
|||||
Chemical Identifiers
| 125-20-2 | |
| 430.544 | |
| LDKDGDIWEUUXSH-UHFFFAOYSA-N | |
| 31316 | |
| CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O |
| C28H30O4 | |
| MFCD00005909 | |
| thymolphthalein, thymophthalein, unii-yg5i28wsqp, yg5i28wsqp, phenolphthalein, 5',5-diisopropyl-2',2-dimethyl, 3,3-bis 4-hydroxy-5-isopropyl-2-methylphenyl-2-benzofuran-1 3h-one, 1 3h-isobenzofuranone, 3,3-bis 4-hydroxy-2-methyl-5-1-methylethyl phenyl, 5',5-diisopropyl-2',2-dimethylphenolphthalein, 3,3-bis 4-hydroxy-2-methyl-5-propan-2-ylphenyl-2-benzofuran-1-one | |
| 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one |
Specifications
| 125-20-2 | |
| C28H30O4 | |
| 100 mL | |
| thymolphthalein, thymophthalein, unii-yg5i28wsqp, yg5i28wsqp, phenolphthalein, 5',5-diisopropyl-2',2-dimethyl, 3,3-bis 4-hydroxy-5-isopropyl-2-methylphenyl-2-benzofuran-1 3h-one, 1 3h-isobenzofuranone, 3,3-bis 4-hydroxy-2-methyl-5-1-methylethyl phenyl, 5',5-diisopropyl-2',2-dimethylphenolphthalein, 3,3-bis 4-hydroxy-2-methyl-5-propan-2-ylphenyl-2-benzofuran-1-one | |
| CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O | |
| 430.544 | |
| 430.54 | |
| Thymolphthalein (0.1% in ca. 95% Ethanol) [for pH Determination and Titration] |
| Colorless | |
| MFCD00005909 | |
| 1170 | |
| LDKDGDIWEUUXSH-UHFFFAOYSA-N | |
| 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one | |
| 31316 | |
| Liquid |
Safety and Handling
TSCA : Yes