missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thymolphthalein (0.1% in ca. 95% Ethanol) [for pH Determination and Titration], TCI America™
Supplier: TCI America T0130500ML
| Quantity | 500 mL |
|---|
Chemical Identifiers
| 125-20-2 | |
| 430.544 | |
| LDKDGDIWEUUXSH-UHFFFAOYSA-N | |
| 31316 | |
| CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O |
| C28H30O4 | |
| MFCD00005909 | |
| thymolphthalein, thymophthalein, unii-yg5i28wsqp, yg5i28wsqp, phenolphthalein, 5',5-diisopropyl-2',2-dimethyl, 3,3-bis 4-hydroxy-5-isopropyl-2-methylphenyl-2-benzofuran-1 3h-one, 1 3h-isobenzofuranone, 3,3-bis 4-hydroxy-2-methyl-5-1-methylethyl phenyl, 5',5-diisopropyl-2',2-dimethylphenolphthalein, 3,3-bis 4-hydroxy-2-methyl-5-propan-2-ylphenyl-2-benzofuran-1-one | |
| 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one |
Specifications
| Thymolphthalein (0.1% in ca. 95% Ethanol) [for pH Determination and Titration] | |
| Colorless | |
| 500 mL | |
| 1170 | |
| LDKDGDIWEUUXSH-UHFFFAOYSA-N | |
| 3,3-bis(4-hydroxy-2-methyl-5-propan-2-ylphenyl)-2-benzofuran-1-one | |
| 31316 | |
| Liquid |
| 125-20-2 | |
| C28H30O4 | |
| MFCD00005909 | |
| thymolphthalein, thymophthalein, unii-yg5i28wsqp, yg5i28wsqp, phenolphthalein, 5',5-diisopropyl-2',2-dimethyl, 3,3-bis 4-hydroxy-5-isopropyl-2-methylphenyl-2-benzofuran-1 3h-one, 1 3h-isobenzofuranone, 3,3-bis 4-hydroxy-2-methyl-5-1-methylethyl phenyl, 5',5-diisopropyl-2',2-dimethylphenolphthalein, 3,3-bis 4-hydroxy-2-methyl-5-propan-2-ylphenyl-2-benzofuran-1-one | |
| CC1=CC(=C(C=C1C2(C3=CC=CC=C3C(=O)O2)C4=CC(=C(C=C4C)O)C(C)C)C(C)C)O | |
| 430.544 | |
| 430.54 |
Safety and Handling
TSCA : Yes