Learn More
Thymol Blue Sodium Salt, ACS Grade, LabChem™
Supplier: LabChem LC260157
Specifications
| Thymol Blue Sodium Salt | |
| 100 | |
| C27H29NaO5S | |
| Soluble in water | |
| OCMIKNBSIRSUPI-FRWNMSGJSA-M | |
| sodium 2-{[4-hydroxy-2-methyl-5-(propan-2-yl)phenyl][(1E)-2-methyl-4-oxo-5-(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]methyl}benzene-1-sulfonate | |
| 23692293 | |
| ACS | |
| Sulfur compounds; Carbon monoxide; Carbon dioxide | |
| 5 g |
| 62625-21-2 | |
| C27H29NaO5S | |
| MFCD00151093 | |
| Passes Test | |
| [Na+].CC(C)C1=C\C(=C(\C2=CC(C(C)C)=C(O)C=C2C)C2=C(C=CC=C2)S([O-])(=O)=O)C(C)=CC1=O | |
| 488.57 | |
| 488.58 | |
| Amber Glass | |
| Gray/Green | |
| Powder |
Chemical Identifiers
| 62625-21-2 | |
| 488.57 | |
| OCMIKNBSIRSUPI-FRWNMSGJSA-M | |
| sodium 2-{[4-hydroxy-2-methyl-5-(propan-2-yl)phenyl][(1E)-2-methyl-4-oxo-5-(propan-2-yl)cyclohexa-2,5-dien-1-ylidene]methyl}benzene-1-sulfonate |
| C27H29NaO5S | |
| MFCD00151093 | |
| 23692293 | |
| [Na+].CC(C)C1=C\C(=C(\C2=CC(C(C)C)=C(O)C=C2C)C2=C(C=CC=C2)S([O-])(=O)=O)C(C)=CC1=O |
Safety and Handling
GHS H Statement
Product is not hazardous.
GHS P Statement
Wear eye protection, protective gloves.
Wash exposed skin thoroughly after handling.
If on skin: Wash with plenty of soap and water.
Take off contaminated clothing.
If skin irritation occurs: Get medical advice/attention.
If in eyes: Rinse cautiously with water for several minutes.
Remove contact lenses, if present and easy to do.
Continue rinsing.
If eye irritation persists: Get medical advice/attention.
Recommended Storage : Room Temperature