missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thioflavine T, tech. 75%
A dye used to visualize beta-amyloid plaques, like those associated with Alzheimer's Disease | CAS: 2390-54-7 | C17H19ClN2S | 318.86 g/mol
$49.45 - $125.51
Chemical Identifiers
| CAS | 2390-54-7 |
|---|---|
| Molecular Formula | C17H19ClN2S |
| Molecular Weight (g/mol) | 318.86 |
| MDL Number | MFCD00011944 |
| InChI Key | JADVWWSKYZXRGX-UHFFFAOYSA-M |
| Synonym | Basic Yellow 1; C.I. 49005 |
| PubChem CID | 16953 |
| ChEBI | CHEBI:76023 |
| IUPAC Name | 4-(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline;chloride |
| SMILES | [Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAJ6104306
|
Thermo Scientific Chemicals
J6104306 |
5 g |
Each for $49.45
|
|
|||||
|
AAJ6104314
|
Thermo Scientific Chemicals
J6104314 |
25 g |
Each for $125.51
|
|
|||||
Description
A dye used to visualize beta-amyloid plaques, like those associated with Alzheimer's Disease
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 2390-54-7 | |
| 318.86 | |
| JADVWWSKYZXRGX-UHFFFAOYSA-M | |
| 16953 | |
| 4-(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline;chloride |
| C17H19ClN2S | |
| MFCD00011944 | |
| Basic Yellow 1; C.I. 49005 | |
| CHEBI:76023 | |
| [Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1 |
Specifications
| 2390-54-7 | |
| MFCD00011944 | |
| Basic Yellow 1; C.I. 49005 | |
| [Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1 | |
| 318.86 | |
| CHEBI:76023 | |
| 75% | |
| Yellow | |
| Powder |
| C17H19ClN2S | |
| 3922452 | |
| JADVWWSKYZXRGX-UHFFFAOYSA-M | |
| 4-(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline;chloride | |
| 16953 | |
| 318.86 | |
| Technical | |
| 5 g | |
| Thioflavine T |
Safety and Handling
EINECSNumber : 219-228-9
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only