Learn More
Thioflavine T, tech. 75%
A dye used to visualize beta-amyloid plaques, like those associated with Alzheimer's Disease | CAS: 2390-54-7 | C17H19ClN2S | 318.86 g/mol
Supplier: Thermo Scientific Chemicals J6104306
Description
A dye used to visualize beta-amyloid plaques, like those associated with Alzheimer's Disease
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Thioflavine T | |
| C17H19ClN2S | |
| 3922452 | |
| JADVWWSKYZXRGX-UHFFFAOYSA-M | |
| 4-(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline;chloride | |
| 16953 | |
| 318.86 | |
| Technical | |
| 5 g |
| 2390-54-7 | |
| MFCD00011944 | |
| Basic Yellow 1; C.I. 49005 | |
| [Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1 | |
| 318.86 | |
| CHEBI:76023 | |
| 75% | |
| Yellow | |
| Powder |
Chemical Identifiers
| 2390-54-7 | |
| 318.86 | |
| JADVWWSKYZXRGX-UHFFFAOYSA-M | |
| 16953 | |
| 4-(3,6-dimethyl-1,3-benzothiazol-3-ium-2-yl)-N,N-dimethylaniline;chloride |
| C17H19ClN2S | |
| MFCD00011944 | |
| Basic Yellow 1; C.I. 49005 | |
| CHEBI:76023 | |
| [Cl-].CN(C)C1=CC=C(C=C1)C1=[N+](C)C2=CC=C(C)C=C2S1 |
Safety and Handling
EINECSNumber : 219-228-9
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only