missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thiamine Mononitrate, FCC, 98-102%, Spectrum™ Chemical
T1054, 532-43-4, C12H17N5O4S
$1,011.00 - $1,011.00
Chemical Identifiers
| CAS | 532-43-4 |
|---|---|
| Molecular Formula | C12H17N5O4S |
| Molecular Weight (g/mol) | 327.36 |
| MDL Number | MFCD00036330 |
| InChI Key | UIERGBJEBXXIGO-UHFFFAOYSA-N |
| IUPAC Name | 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-hydroxyethyl)-4-methyl-3H-1λâ´,3-thiazol-1-ylium nitrate |
| SMILES | [O-][N+]([O-])=O.CC1=C(CCO)[S+]=CN1CC1=CN=C(C)N=C1N |
Description
Spectrum™ Chemical Thiamine Mononitrate, FCC is in the B vitamin group and is water soluble. The FCC grade meets the requirements of the Food Chemical Codex indicates and is suitable for all food, beverage and nutritional supplement applications. Spectrum Chemical offers over 300 Food grade chemical ingredients packaged in laboratory size bottles to production drum quantities and are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Chemical Identifiers
| 532-43-4 | |
| 327.36 | |
| UIERGBJEBXXIGO-UHFFFAOYSA-N | |
| [O-][N+]([O-])=O.CC1=C(CCO)[S+]=CN1CC1=CN=C(C)N=C1N |
| C12H17N5O4S | |
| MFCD00036330 | |
| 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-hydroxyethyl)-4-methyl-3H-1λâ´,3-thiazol-1-ylium nitrate |
Specifications
| 532-43-4 | |
| 6.0 to 7.5 | |
| 0.01 | |
| C12H17N5O4S | |
| 500 g | |
| [O-][N+]([O-])=O.CC1=C(CCO)[S+]=CN1CC1=CN=C(C)N=C1N | |
| 327.36 | |
| FCC |
| 1 | |
| 0.002 | |
| Amber Glass Bottle | |
| MFCD00036330 | |
| UIERGBJEBXXIGO-UHFFFAOYSA-N | |
| 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-hydroxyethyl)-4-methyl-3H-1λâ´,3-thiazol-1-ylium nitrate | |
| 98 to 102% |