missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thiamine Mononitrate, FCC, 98-102%, Spectrum™ Chemical
T1054, 532-43-4, C12H17N5O4S
Supplier: Spectrum Chemical Mfg Cor T1054500GM
Description
Spectrum™ Chemical Thiamine Mononitrate, FCC is in the B vitamin group and is water soluble. The FCC grade meets the requirements of the Food Chemical Codex indicates and is suitable for all food, beverage and nutritional supplement applications. Spectrum Chemical offers over 300 Food grade chemical ingredients packaged in laboratory size bottles to production drum quantities and are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.Specifications
| 532-43-4 | |
| 6.0 to 7.5 | |
| 0.01 | |
| C12H17N5O4S | |
| 500 g | |
| [O-][N+]([O-])=O.CC1=C(CCO)[S+]=CN1CC1=CN=C(C)N=C1N | |
| 327.36 | |
| FCC |
| 1 | |
| 0.002 | |
| Amber Glass Bottle | |
| MFCD00036330 | |
| UIERGBJEBXXIGO-UHFFFAOYSA-N | |
| 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-hydroxyethyl)-4-methyl-3H-1λâ´,3-thiazol-1-ylium nitrate | |
| 98 to 102% |
Chemical Identifiers
| 532-43-4 | |
| 327.36 | |
| UIERGBJEBXXIGO-UHFFFAOYSA-N | |
| [O-][N+]([O-])=O.CC1=C(CCO)[S+]=CN1CC1=CN=C(C)N=C1N |
| C12H17N5O4S | |
| MFCD00036330 | |
| 3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-hydroxyethyl)-4-methyl-3H-1λâ´,3-thiazol-1-ylium nitrate |