missing translation for 'onlineSavingsMsg'
Learn More
Learn More
tert-Butyl 5-Norbornene-2-carboxylate (endo- and exo- mixture) 95.0+%, TCI America™
Supplier: TCI America B426725G
Specifications
| tert-Butyl 5-Norbornene-2-carboxylate (endo- and exo- mixture) | |
| Yellow | |
| C12H18O2 | |
| 25 g | |
| BZBMBZJUNPMEBD-UHFFFAOYSA-N | |
| tert-butyl bicyclo[2.2.1]hept-2-ene-5-carboxylate | |
| 15607334 | |
| ≥95.0% (GC) |
| 154970-45-3 | |
| 103°C | |
| MFCD18083704 | |
| 5-Norbornene-2-carboxylic Acid tert-Butyl Ester, tert-Butyl Bicyclo[2.2.1]hept-5-ene-2-carboxylate, Bicyclo[2.2.1]hept-5-ene-2-carboxylic Acid tert-Butyl Ester | |
| CC(C)(C)OC(=O)C1CC2CC1C=C2 | |
| 194.274 | |
| 194.27 | |
| Liquid |
Chemical Identifiers
| 154970-45-3 | |
| 194.274 | |
| BZBMBZJUNPMEBD-UHFFFAOYSA-N | |
| 15607334 | |
| CC(C)(C)OC(=O)C1CC2CC1C=C2 |
| C12H18O2 | |
| MFCD18083704 | |
| 5-Norbornene-2-carboxylic Acid tert-Butyl Ester, tert-Butyl Bicyclo[2.2.1]hept-5-ene-2-carboxylate, Bicyclo[2.2.1]hept-5-ene-2-carboxylic Acid tert-Butyl Ester | |
| tert-butyl bicyclo[2.2.1]hept-2-ene-5-carboxylate |
Safety and Handling
TSCA : Yes