Learn More
tert-Butyl 2,2,2-trichloroacetimidate, 95%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 369330250
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Alkylation reagentSpecifications
| tert-Butyl 2, 2, 2-trichloroacetimidate | |
| 1.2220g/mL | |
| 55°C | |
| 94% min. (GC) | |
| C6H10Cl3NO | |
| CCl3C(=NH)OC(CH3)3 | |
| 25g | |
| tert-butyl 2,2,2-trichloroacetimidate, tert-butyl trichloroacetimidate, tert-butyl-2,2,2-trichloroacetimidate, tert-butyl 2,2,2-trichloroethanecarboximidate, 2,2,2-trichloroacetimidic acid tert-butyl ester, t-butyl trichloroacetimidate, t-butyl 2,2,2-trichloroacetimidate, tert-butyl2,2,2-trichloroacetimidate, ethanimidic acid, 2,2,2-trichloro-, 1,1-dimethylethyl ester, 1-tert-butoxy-2,2,2-trichloroethanimine | |
| CC(C)(C)OC(=N)C(Cl)(Cl)Cl | |
| 218.50 | |
| 218.51 |
| 98946-18-0 | |
| 64.0°C to 66.0°C (15.0mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4550 to 1.4570 | |
| MFCD00077410 | |
| 1.222 | |
| CQXDYHPBXDZWBA-UHFFFAOYSA-N | |
| tert-butyl 2,2,2-trichloroethanimidate | |
| 2734700 | |
| 95% |
Chemical Identifiers
| 98946-18-0 | |
| 218.50 | |
| CQXDYHPBXDZWBA-UHFFFAOYSA-N | |
| 2734700 | |
| CC(C)(C)OC(=N)C(Cl)(Cl)Cl |
| C6H10Cl3NO | |
| MFCD00077410 | |
| tert-butyl 2,2,2-trichloroacetimidate, tert-butyl trichloroacetimidate, tert-butyl-2,2,2-trichloroacetimidate, tert-butyl 2,2,2-trichloroethanecarboximidate, 2,2,2-trichloroacetimidic acid tert-butyl ester, t-butyl trichloroacetimidate, t-butyl 2,2,2-trichloroacetimidate, tert-butyl2,2,2-trichloroacetimidate, ethanimidic acid, 2,2,2-trichloro-, 1,1-dimethylethyl ester, 1-tert-butoxy-2,2,2-trichloroethanimine | |
| tert-butyl 2,2,2-trichloroethanimidate |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
Flammable liquid and vapor.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning
RUO â Research Use Only