missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Terephthalic acid, 99+%
CAS: 100-21-0 | C8H6O4 | 166.13 g/mol
Supplier: Thermo Scientific Chemicals 180720010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Terephthalic acid | |
| >300.0°C | |
| Authentic | |
| Plastic bottle | |
| MFCD00002558 | |
| 09,841 | |
| p-phthalic acid, 1,4-benzenedicarboxylic acid, benzene-1,4-dicarboxylic acid, p-dicarboxybenzene, p-benzenedicarboxylic acid, p-carboxybenzoic acid, acide terephtalique, para-phthalic acid, tephthol, 1,4-dicarboxybenzene | |
| Solubility in water: insoluble. Other solubilities: soluble in alkalies, slightly soluble in alcohol, insoluble in chloroform, ether and acetic acid | |
| C1=CC(=CC=C1C(=O)O)C(=O)O | |
| 166.13 | |
| CHEBI:15702 | |
| 99+% |
| 100-21-0 | |
| White | |
| 99+% | |
| C8H6O4 | |
| 1 kg | |
| 15,9305 | |
| 0402.0°C | |
| KKEYFWRCBNTPAC-UHFFFAOYSA-N | |
| terephthalic acid | |
| 7489 | |
| 166.13 | |
| Crystalline Powder |
Chemical Identifiers
| 100-21-0 | |
| 166.13 | |
| KKEYFWRCBNTPAC-UHFFFAOYSA-N | |
| 7489 | |
| terephthalic acid |
| C8H6O4 | |
| MFCD00002558 | |
| p-phthalic acid, 1,4-benzenedicarboxylic acid, benzene-1,4-dicarboxylic acid, p-dicarboxybenzene, p-benzenedicarboxylic acid, p-carboxybenzoic acid, acide terephtalique, para-phthalic acid, tephthol, 1,4-dicarboxybenzene | |
| CHEBI:15702 | |
| C1=CC(=CC=C1C(=O)O)C(=O)O |
Safety and Handling
EINECSNumber : 202-830-
RUO – Research Use Only