missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Tenofovir disoproxil fumarate, 98%, Thermo Scientific Chemicals
$100.53 - $822.24
Chemical Identifiers
| CAS | 202138-50-9 |
|---|---|
| Molecular Formula | C19H30N5O10P·C4H4O4 |
| Molecular Weight (g/mol) | 635.51 |
| InChI Key | VCMJCVGFSROFHV-WZGZYPNHSA-N |
| Synonym | tenofovir disoproxil fumarate, viread, tenofovir df, unii-ott9j7900i, tenofovir disoproxil fumarate usan, 9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine fumarate, 9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine, fumarate, r-5-2-6-amino-9h-purin-9-yl-1-methylethoxy methyl-2,4,6,8-tetraoxa-5-phosphanonanedioic acid, bis 1-methylethyl ester, 5-oxide, e-2-butenedioate 1:1, 9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine fumarate 1:1 |
| PubChem CID | 6398764 |
| ChEBI | CHEBI:63718 |
| IUPAC Name | [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid |
| SMILES | CC(C)OC(=O)OCOP(=O)(COC(C)CN1C=NC2=C1N=CN=C2N)OCOC(=O)OC(C)C.C(=CC(=O)O)C(=O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC461250010
|
Thermo Scientific Chemicals
461250010 |
1 g |
Each for $100.53
|
|
|||||
|
AC461250050
|
Thermo Scientific Chemicals
461250050 |
5 g |
Each for $284.26
|
|
|||||
|
AC461250250
|
Thermo Scientific Chemicals
461250250 |
25 g |
Each for $822.24
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 202138-50-9 | |
| 635.51 | |
| tenofovir disoproxil fumarate, viread, tenofovir df, unii-ott9j7900i, tenofovir disoproxil fumarate usan, 9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine fumarate, 9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine, fumarate, r-5-2-6-amino-9h-purin-9-yl-1-methylethoxy methyl-2,4,6,8-tetraoxa-5-phosphanonanedioic acid, bis 1-methylethyl ester, 5-oxide, e-2-butenedioate 1:1, 9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine fumarate 1:1 | |
| CHEBI:63718 | |
| CC(C)OC(=O)OCOP(=O)(COC(C)CN1C=NC2=C1N=CN=C2N)OCOC(=O)OC(C)C.C(=CC(=O)O)C(=O)O |
| C19H30N5O10P·C4H4O4 | |
| VCMJCVGFSROFHV-WZGZYPNHSA-N | |
| 6398764 | |
| [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid |
Specifications
| 202138-50-9 | |
| 97.5% min. (HPLC) | |
| C19H30N5O10P·C4H4O4 | |
| tenofovir disoproxil fumarate, viread, tenofovir df, unii-ott9j7900i, tenofovir disoproxil fumarate usan, 9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine fumarate, 9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine, fumarate, r-5-2-6-amino-9h-purin-9-yl-1-methylethoxy methyl-2,4,6,8-tetraoxa-5-phosphanonanedioic acid, bis 1-methylethyl ester, 5-oxide, e-2-butenedioate 1:1, 9-r-2-bis isopropoxycarbonyl oxy methoxy phosphinyl methoxy propyl adenine fumarate 1:1 | |
| VCMJCVGFSROFHV-WZGZYPNHSA-N | |
| [[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-(propan-2-yloxycarbonyloxymethoxy)phosphoryl]oxymethyl propan-2-yl carbonate;(E)-but-2-enedioic acid | |
| 6398764 | |
| 635.51 | |
| Tenofovir disoproxil fumarate |
| Authentic | |
| Glass Bottle | |
| 1 g | |
| Solubility in water: >10 mg/mL. | |
| CC(C)OC(=O)OCOP(=O)(COC(C)CN1C=NC2=C1N=CN=C2N)OCOC(=O)OC(C)C.C(=CC(=O)O)C(=O)O | |
| 635.51 | |
| CHEBI:63718 | |
| 98% |
RUO – Research Use Only