missing translation for 'onlineSavingsMsg'
Learn More
Learn More
TBPE (=Tetrabromophenolphthalein Ethyl Ester Potassium Salt) 98.0+%, TCI America™
[Sensitive spectrophotometric reagent for amines, quaternary ammonium salts and other cations]
Supplier: TCI America A51071G
Specifications
| TBPE (=Tetrabromophenolphthalein Ethyl Ester Potassium Salt) [Sensitive spectrophotometric re | |
| 210°C | |
| C22H13Br4KO4 | |
| 1 g | |
| WCIQBKUTYDIBJC-UHFFFAOYSA-M | |
| potassium 2,6-dibromo-4-[(3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene)[2-(ethoxycarbonyl)phenyl]methyl]benzen-1-olate | |
| 23689366 | |
| ≥98.0% (HPLC) |
| 62637-91-6 | |
| Black-Green | |
| MFCD00011662 | |
| potassium tetrabromophenolphthalein ethyl ester, tetrabromophenolphthalein ethyl ester potassium salt, potassium 2,6-dibromo-4-3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene 2-ethoxycarbonyl phenyl methyl phenolate, potassium 2,6-dibromo-4-3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene 2-ethoxycarbonyl phenyl methyl benzenolate, dj-2, benzoic acid, 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl-, ethyl ester, potassium salt, benzoic acid, 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl-, ethyl ester, potassium salt 1:1, tetrabromophenolphthalein ethyl ester potassium, 3',3,5',5-tetrabromophenolphthalein ethyl ester potassium salt | |
| [K+].CCOC(=O)C1=CC=CC=C1C(C1=CC(Br)=C([O-])C(Br)=C1)=C1C=C(Br)C(=O)C(Br)=C1 | |
| 700.06 | |
| 700.06 | |
| Crystalline Powder |
Chemical Identifiers
| 62637-91-6 | |
| 700.06 | |
| WCIQBKUTYDIBJC-UHFFFAOYSA-M | |
| 23689366 | |
| [K+].CCOC(=O)C1=CC=CC=C1C(C1=CC(Br)=C([O-])C(Br)=C1)=C1C=C(Br)C(=O)C(Br)=C1 |
| C22H13Br4KO4 | |
| MFCD00011662 | |
| potassium tetrabromophenolphthalein ethyl ester, tetrabromophenolphthalein ethyl ester potassium salt, potassium 2,6-dibromo-4-3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene 2-ethoxycarbonyl phenyl methyl phenolate, potassium 2,6-dibromo-4-3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene 2-ethoxycarbonyl phenyl methyl benzenolate, dj-2, benzoic acid, 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl-, ethyl ester, potassium salt, benzoic acid, 2-3,5-dibromo-4-hydroxyphenyl 3,5-dibromo-4-oxo-2,5-cyclohexadien-1-ylidene methyl-, ethyl ester, potassium salt 1:1, tetrabromophenolphthalein ethyl ester potassium, 3',3,5',5-tetrabromophenolphthalein ethyl ester potassium salt | |
| potassium 2,6-dibromo-4-[(3,5-dibromo-4-oxocyclohexa-2,5-dien-1-ylidene)[2-(ethoxycarbonyl)phenyl]methyl]benzen-1-olate |
Safety and Handling
TSCA : Yes