missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Talniflumate 98.0+%, TCI America™
Supplier: TCI America T3101200MG
Specifications
| Talniflumate | |
| 168°C | |
| C21H13F3N2O4 | |
| 200 mg | |
| ANMLJLFWUCQGKZ-UHFFFAOYNA-N | |
| 3-oxo-1,3-dihydro-2-benzofuran-1-yl 2-{[3-(trifluoromethyl)phenyl]amino}pyridine-3-carboxylate | |
| 48229 | |
| ≥98.0% (HPLC,N) |
| 66898-62-2 | |
| Yellow | |
| MFCD00866135 | |
| talniflumate, somalgen, lomucin, talniflumato, talniflumate usan:inn, talniflumatum inn-latin, talniflumato inn-spanish, phthalidyl 2-3-trifluoromethylanilino nicotinate, 3-phthalidyl ester of 2-3-trifluoromethyl phenyl amino-3-pyridinecarboxylic acid, phthalidyl 2-alpha,alpha,alpha-trifluoro-m-toluidino nicotinate | |
| FC(F)(F)C1=CC=CC(NC2=NC=CC=C2C(=O)OC2OC(=O)C3=CC=CC=C23)=C1 | |
| 414.34 | |
| 414.34 | |
| Crystalline Powder |
Chemical Identifiers
| 66898-62-2 | |
| 414.34 | |
| ANMLJLFWUCQGKZ-UHFFFAOYNA-N | |
| 48229 | |
| FC(F)(F)C1=CC=CC(NC2=NC=CC=C2C(=O)OC2OC(=O)C3=CC=CC=C23)=C1 |
| C21H13F3N2O4 | |
| MFCD00866135 | |
| talniflumate, somalgen, lomucin, talniflumato, talniflumate usan:inn, talniflumatum inn-latin, talniflumato inn-spanish, phthalidyl 2-3-trifluoromethylanilino nicotinate, 3-phthalidyl ester of 2-3-trifluoromethyl phenyl amino-3-pyridinecarboxylic acid, phthalidyl 2-alpha,alpha,alpha-trifluoro-m-toluidino nicotinate | |
| 3-oxo-1,3-dihydro-2-benzofuran-1-yl 2-{[3-(trifluoromethyl)phenyl]amino}pyridine-3-carboxylate |
Safety and Handling
RTECSNumber : QT2999200
TSCA : No
Recommended Storage : Refrigerator