missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Succinyl sulfathiazole, 99.48%, MP Biomedicals™
Succinylsulfathiazole is used to block the synthesis of folic acid. It is used to study folate deficiency
$621.72 - $621.72
Chemical Identifiers
| CAS | 116-43-8 |
|---|---|
| Molecular Formula | C13H13N3O5S2 |
| Molecular Weight (g/mol) | 355.383 |
| MDL Number | MFCD00022437 |
| InChI Key | SKVLYVHULOWXTD-UHFFFAOYSA-N |
| Synonym | succinylsulfathiazole, cremosuxidine, sulfasuccidine, sulfasuccinil, sulfasuxidine, colistatin, sulfadigesin, sulfasuccithiazole, sulfasuccidin, sulfenterone |
| PubChem CID | 5315 |
| ChEBI | CHEBI:9309 |
| IUPAC Name | 4-oxo-4-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]butanoic acid |
| SMILES | C1=CC(=CC=C1NC(=O)CCC(=O)O)S(=O)(=O)NC2=NC=CS2 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN10297690
|
MP Biomedicals Inc
0210297690 |
500 g |
Each for $621.72
|
|
|||||
Chemical Identifiers
| 116-43-8 | |
| 355.383 | |
| SKVLYVHULOWXTD-UHFFFAOYSA-N | |
| 5315 | |
| 4-oxo-4-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]butanoic acid |
| C13H13N3O5S2 | |
| MFCD00022437 | |
| succinylsulfathiazole, cremosuxidine, sulfasuccidine, sulfasuccinil, sulfasuxidine, colistatin, sulfadigesin, sulfasuccithiazole, sulfasuccidin, sulfenterone | |
| CHEBI:9309 | |
| C1=CC(=CC=C1NC(=O)CCC(=O)O)S(=O)(=O)NC2=NC=CS2 |
Specifications
| 116-43-8 | |
| C13H13N3O5S2 | |
| 500 g | |
| SKVLYVHULOWXTD-UHFFFAOYSA-N | |
| 4-oxo-4-[4-(1,3-thiazol-2-ylsulfamoyl)anilino]butanoic acid | |
| 5315 | |
| 355.4 | |
| Succinyl sulfathiazole |
| White | |
| MFCD00022437 | |
| succinylsulfathiazole, cremosuxidine, sulfasuccidine, sulfasuccinil, sulfasuxidine, colistatin, sulfadigesin, sulfasuccithiazole, sulfasuccidin, sulfenterone | |
| C1=CC(=CC=C1NC(=O)CCC(=O)O)S(=O)(=O)NC2=NC=CS2 | |
| 355.383 | |
| CHEBI:9309 | |
| Powder |
Safety and Handling
EINECSNumber : 204-141-0