missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Strontium Nitrate Anhydrous (Crystalline/Certified ACS), Fisher Chemical™
Supplier: Thermo Fisher Scientific S549500
Specifications
| Strontium Nitrate Anhydrous | |
| 10042-76-9 | |
| 5.0 to 7.0 | |
| 500 g | |
| N2O6Sr | |
| MFCD00011248 | |
| DHEQXMRUPNDRPG-UHFFFAOYSA-N | |
| strontium(2+) dinitrate | |
| 24848 | |
| ≥99% | |
| Pass Test | |
| Glass Bottle |
| 570°C | |
| White | |
| Solid | |
| ≥99 % | |
| Sr(NO3)2 | |
| strontium nitrate, strontium dinitrate, nitric acid, strontium salt, strontium ii nitrate 1:2, unii-bdg873aqzl, nitrate de strontium french, hsdb 787, strontium nitrate sr no3 2, bdg873aqzl, nitric acid, strontium salt 2:1 | |
| [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O | |
| 211.63 | |
| 211.63 | |
| Certified ACS | |
| 0.1% max. |
Chemical Identifiers
| 10042-76-9 | |
| 211.63 | |
| DHEQXMRUPNDRPG-UHFFFAOYSA-N | |
| 24848 | |
| [Sr++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| N2O6Sr | |
| MFCD00011248 | |
| strontium nitrate, strontium dinitrate, nitric acid, strontium salt, strontium ii nitrate 1:2, unii-bdg873aqzl, nitrate de strontium french, hsdb 787, strontium nitrate sr no3 2, bdg873aqzl, nitric acid, strontium salt 2:1 | |
| strontium(2+) dinitrate |
Safety and Handling
DANGER!
Emergency Overview
Oxidizer: Contact with combustible/organic material may cause fire. Irritating to eyes, respiratory system and skin. Use personal protective equipment. Keep away from clothing and other combustible materials. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Do not use mouth-to-mouth resuscitation if victim ingested or inhaled the substance; induce artifici. Obtain medical attention. Obtain medical attention. Do not induce vomiting.
NFPA
Health:2
Flammability:0
Instability:2
DOTInformation : DOT Class 5.1, : Oxidizer