missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Starch, for biochemistry, potato, hydrolyzed for electrophoresis
CAS: 9005-25-8 | C12H22O11 | 342.30 g/mol
Supplier: Thermo Scientific Chemicals 215125000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| White | |
| Hydrolyzed for Electrophoresis | |
| 9005-25-8 | |
| MFCD00082026,MFCD00132834 | |
| alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose | |
| 500 g | |
| OCC1OC(OC2C(O)C(O)C(O)OC2CO)C(O)C(O)C1O | |
| 342.30 | |
| CHEBI:18167 | |
| Authentic | |
| Plastic bottle |
| Starch | |
| Fine Crystalline Powder | |
| C12H22O11 | |
| 14, 8798 | |
| Solubility in water: insoluble. | |
| GUBGYTABKSRVRQ-UHFFFAOYNA-N | |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol | |
| 439341 | |
| Biochemical | |
| 20% max. | |
| 1% max. |
Chemical Identifiers
| 9005-25-8 | |
| 342.30 | |
| GUBGYTABKSRVRQ-UHFFFAOYNA-N | |
| 439341 | |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| C12H22O11 | |
| MFCD00082026,MFCD00132834 | |
| alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose | |
| CHEBI:18167 | |
| OCC1OC(OC2C(O)C(O)C(O)OC2CO)C(O)C(O)C1O |
RUO – Research Use Only