missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Starch, for analysis, soluble
CAS: 9005-84-9 | C12H22O11 | 342.297 g/mol
Supplier: Thermo Scientific Chemicals 177130010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| White | |
| 5 to 7.5 (2% soln. at 25°C) | |
| Amorphous Powder | |
| 256.0°C to 258.0°C | |
| MFCD00082026 | |
| alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose | |
| 1 kg | |
| C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O | |
| 342.297 | |
| CHEBI:18167 | |
| positive | |
| 10% max. | |
| passes |
| Starch | |
| Soluble, For analysis | |
| 9005-84-9 | |
| C12H22O11 | |
| 15, 8926 | |
| Solubility in water: 50g/L (90°C). | |
| GUBGYTABKSRVRQ-ASMJPISFSA-N | |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol | |
| 439341 | |
| Analytical | |
| Authentic | |
| Plastic bottle |
Chemical Identifiers
| 9005-84-9 | |
| 342.297 | |
| GUBGYTABKSRVRQ-ASMJPISFSA-N | |
| 439341 | |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| C12H22O11 | |
| MFCD00082026 | |
| alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose | |
| CHEBI:18167 | |
| C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
RUO – Research Use Only