missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Starch, for analysis, soluble
CAS: 9005-84-9 | C12H22O11 | 342.297 g/mol
$87.27 - $233.57
Chemical Identifiers
| CAS | 9005-84-9 |
|---|---|
| Molecular Formula | C12H22O11 |
| Molecular Weight (g/mol) | 342.297 |
| MDL Number | MFCD00082026 |
| InChI Key | GUBGYTABKSRVRQ-ASMJPISFSA-N |
| Synonym | alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose |
| PubChem CID | 439341 |
| ChEBI | CHEBI:18167 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC177132500
|
Thermo Scientific Chemicals
177132500 |
250 g | Plastic bottle |
Each for $87.27
|
|
||||
|
AC177130010
|
Thermo Scientific Chemicals
177130010 |
1 kg | Plastic bottle |
Each for $233.57
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 9005-84-9 | |
| 342.297 | |
| GUBGYTABKSRVRQ-ASMJPISFSA-N | |
| 439341 | |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol |
| C12H22O11 | |
| MFCD00082026 | |
| alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose | |
| CHEBI:18167 | |
| C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
Specifications
| White | |
| Amorphous Powder | |
| 256.0°C to 258.0°C | |
| MFCD00082026 | |
| alpha-maltose, maltose, starch, soluble, glcalpha1-4glca, unii-15sug9ad26, glcalpha1-4glcalpha, amylodextrin, starch solution, alpha-malt sugar, 4-o-alpha-d-glucopyranosyl-alpha-d-glucopyranose | |
| 250 g | |
| C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O | |
| 342.297 | |
| CHEBI:18167 | |
| positive | |
| 10% max. | |
| passes |
| 5 to 7.5 (2% soln. at 25°C) | |
| 9005-84-9 | |
| C12H22O11 | |
| 15, 8926 | |
| Solubility in water: 50g/L (90°C). | |
| GUBGYTABKSRVRQ-ASMJPISFSA-N | |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol | |
| 439341 | |
| Analytical | |
| Authentic | |
| Plastic bottle | |
| Starch, Soluble, For analysis |
RUO – Research Use Only