missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Squaric Acid Dibutyl Ester, 97%
CAS: 2892-62-8 | C12H18O4 | 226.27 g/mol
$72.76 - $170.71
Chemical Identifiers
| CAS | 2892-62-8 |
|---|---|
| Molecular Formula | C12H18O4 |
| Molecular Weight (g/mol) | 226.27 |
| MDL Number | MFCD00037150 |
| InChI Key | XBRWELTXMQSEIN-UHFFFAOYSA-N |
| Synonym | dibutyl squarate, 3,4-dibutoxy-3-cyclobutene-1,2-dione, squaric acid dibutyl ester, sadbe, squaric acid dibutylester, 3,4-di-n-butoxy-3-cyclobutene-1,2-dione, unii-4rto57vg65, 1,2-dibutyl squarate, 3-cyclobutene-1,2-dione, 3,4-dibutoxy, acmc-209h5p |
| PubChem CID | 65108 |
| ChEBI | CHEBI:53612 |
| IUPAC Name | 3,4-dibutoxycyclobut-3-ene-1,2-dione |
| SMILES | CCCCOC1=C(OCCCC)C(=O)C1=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC133170010
|
Thermo Scientific Chemicals
133170010 |
1 g | Glass bottle |
Each for $72.76
|
|
||||
|
AC133170050
|
Thermo Scientific Chemicals
133170050 |
5 g | Glass bottle |
Each for $170.71
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 2892-62-8 | |
| 226.27 | |
| XBRWELTXMQSEIN-UHFFFAOYSA-N | |
| 65108 | |
| 3,4-dibutoxycyclobut-3-ene-1,2-dione |
| C12H18O4 | |
| MFCD00037150 | |
| dibutyl squarate, 3,4-dibutoxy-3-cyclobutene-1,2-dione, squaric acid dibutyl ester, sadbe, squaric acid dibutylester, 3,4-di-n-butoxy-3-cyclobutene-1,2-dione, unii-4rto57vg65, 1,2-dibutyl squarate, 3-cyclobutene-1,2-dione, 3,4-dibutoxy, acmc-209h5p | |
| CHEBI:53612 | |
| CCCCOC1=C(OCCCC)C(=O)C1=O |
Specifications
| 2892-62-8 | |
| 1.0500g/mL | |
| >110°C | |
| 96% min. (GC) | |
| C12H18O4 | |
| MFCD00037150 | |
| 1.05 | |
| dibutyl squarate, 3,4-dibutoxy-3-cyclobutene-1,2-dione, squaric acid dibutyl ester, sadbe, squaric acid dibutylester, 3,4-di-n-butoxy-3-cyclobutene-1,2-dione, unii-4rto57vg65, 1,2-dibutyl squarate, 3-cyclobutene-1,2-dione, 3,4-dibutoxy, acmc-209h5p | |
| XBRWELTXMQSEIN-UHFFFAOYSA-N | |
| 3,4-dibutoxycyclobut-3-ene-1,2-dione | |
| 65108 | |
| 226.27 | |
| Liquid |
| Colorless to Yellow | |
| 121.0°C to 122.0°C (0.2 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4930 to 1.4950 | |
| 1 g | |
| 15, 8897 | |
| Solubility in water: insoluble. | |
| CCCCOC1=C(OCCCC)C(=O)C1=O | |
| 226.27 | |
| CHEBI:53612 | |
| 97% | |
| Squaric acid dibutyl ester |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause an allergic skin reaction.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
Wear protective gloves/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF IN EYES: Rinse cautiously with water for several minutes.
GHS Signal Word: Warning
RUO – Research Use Only