Learn More
Thermo Scientific™ Spironolactone, 99%
$117.67 - $381.51
Chemical Identifiers
| CAS | 52-01-7 |
|---|---|
| Molecular Formula | C24H32O4S |
| Molecular Weight (g/mol) | 416.57 |
| MDL Number | MFCD00082250 |
| InChI Key | LXMSZDCAJNLERA-ZHYRCANASA-N |
| Synonym | spironolactone, aldactone, spirolactone, verospiron, euteberol, spiroctan, spirolang, verospirone, aldactone a, spironocompren |
| PubChem CID | 5833 |
| ChEBI | CHEBI:9241 |
| IUPAC Name | S-[(7R,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate |
| SMILES | CC(=O)SC1CC2=CC(=O)CCC2(C3C1C4CCC5(C4(CC3)C)CCC(=O)O5)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity & Availability | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity & Availability | ||||
|
AC207460010
|
Thermo Scientific™
207460010 |
1g | Glass bottle |
Each for $117.67
|
|
||||
|
AC207460050
|
Thermo Scientific™
207460050 |
5g | Glass bottle |
Each for $381.51
|
|
||||
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 52-01-7 | |
| 416.57 | |
| LXMSZDCAJNLERA-ZHYRCANASA-N | |
| 5833 | |
| S-[(7R,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate |
| C24H32O4S | |
| MFCD00082250 | |
| spironolactone, aldactone, spirolactone, verospiron, euteberol, spiroctan, spirolang, verospirone, aldactone a, spironocompren | |
| CHEBI:9241 | |
| CC(=O)SC1CC2=CC(=O)CCC2(C3C1C4CCC5(C4(CC3)C)CCC(=O)O5)C |
Specifications
| 52-01-7 | |
| Authentic | |
| C24H32O4S | |
| 15, 8887 | |
| − 37.00 | |
| Solubility in water: practically insoluble. Other solubilities: soluble in most common organic solvents | |
| CC(=O)SC1CC2=CC(=O)CCC2(C3C1C4CCC5(C4(CC3)C)CCC(=O)O5)C | |
| 416.57 | |
| CHEBI:9241 | |
| 99% |
| 0.5% max. (105°C, 2 hrs) | |
| 98.5% min. (HPLC) | |
| MFCD00082250 | |
| −37° (20°C c=1,CHCl3) | |
| spironolactone, aldactone, spirolactone, verospiron, euteberol, spiroctan, spirolang, verospirone, aldactone a, spironocompren | |
| LXMSZDCAJNLERA-ZHYRCANASA-N | |
| S-[(7R,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate | |
| 5833 | |
| 416.57 | |
| Spironolactone, 99% |
Safety and Handling
GHS H Statement
Suspected of causing cancer.
May damage fertility.
May cause damage to organs through prolonged or repeated exposure.
GHS P Statement
Obtain special instructions before use.
Wear protective gloves/protective clothing/eye protection/face protection.
IF exposed or concerned: Get medical advice/attention.
GHS Signal Word: Danger
EINECSNumber : 200-133-6
RTECSNumber : TU4725000
TSCA : TSCA
RUO – Research Use Only