missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Sparfloxacin, 98%
CAS: 110871-86-8 | C19H22F2N4O3 | 392.41 g/mol
$66.73 - $367.18
Chemical Identifiers
| CAS | 110871-86-8 |
|---|---|
| Molecular Formula | C19H22F2N4O3 |
| Molecular Weight (g/mol) | 392.41 |
| MDL Number | MFCD00869619 |
| InChI Key | DZZWHBIBMUVIIW-DTORHVGOSA-N |
| Synonym | sparfloxacin, zagam, esparfloxacino, sparfloxacine, sparfloxacinum, spara, sparfloxacine inn-french, sparfloxacinum inn-latin, spfx, esparfloxacino inn-spanish |
| PubChem CID | 60464 |
| ChEBI | CHEBI:9212 |
| IUPAC Name | 5-amino-1-cyclopropyl-7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6,8-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| SMILES | C[C@H]1CN(C[C@@H](C)N1)C1=C(F)C(N)=C2C(=O)C(=CN(C3CC3)C2=C1F)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAJ6635803
|
Thermo Scientific Chemicals
J6635803 |
1 g |
Each for $66.73
|
|
|||||
|
AAJ6635809
|
Thermo Scientific Chemicals
J6635809 |
10 g |
Each for $367.18
|
|
|||||
Description
Targets a wide range of Gram-positive, Gram-negative, and mycoplasma species
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 110871-86-8 | |
| 392.41 | |
| DZZWHBIBMUVIIW-DTORHVGOSA-N | |
| 60464 | |
| 5-amino-1-cyclopropyl-7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6,8-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| C19H22F2N4O3 | |
| MFCD00869619 | |
| sparfloxacin, zagam, esparfloxacino, sparfloxacine, sparfloxacinum, spara, sparfloxacine inn-french, sparfloxacinum inn-latin, spfx, esparfloxacino inn-spanish | |
| CHEBI:9212 | |
| C[C@H]1CN(C[C@@H](C)N1)C1=C(F)C(N)=C2C(=O)C(=CN(C3CC3)C2=C1F)C(O)=O |
Specifications
| 110871-86-8 | |
| 640°C | |
| Plastic bottle | |
| MFCD00869619 | |
| 9170271 | |
| Soluble in DMSO at 9mg/ml. Sparingly soluble in water | |
| C[C@H]1CN(C[C@@H](C)N1)C1=C(F)C(N)=C2C(=O)C(=CN(C3CC3)C2=C1F)C(O)=O | |
| 392.41 | |
| CHEBI:9212 | |
| 98% | |
| Sparfloxacin |
| 265°C | |
| >110°C (230°F) | |
| C19H22F2N4O3 | |
| 1 g | |
| sparfloxacin, zagam, esparfloxacino, sparfloxacine, sparfloxacinum, spara, sparfloxacine inn-french, sparfloxacinum inn-latin, spfx, esparfloxacino inn-spanish | |
| DZZWHBIBMUVIIW-DTORHVGOSA-N | |
| 5-amino-1-cyclopropyl-7-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-6,8-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid | |
| 60464 | |
| 392.4 | |
| Powder |
Safety and Handling
RTECSNumber : VB1986500
TSCA : No
Recommended Storage : Keep cold
RUO – Research Use Only