Learn More
Sodium cyclamate, 99%
CAS: 139-05-9 | C6H12NNaO3S | 201.22 g/mol
$63.82 - $157.04
Chemical Identifiers
| CAS | 139-05-9 |
|---|---|
| Molecular Formula | C6H12NNaO3S |
| Molecular Weight (g/mol) | 201.22 |
| MDL Number | MFCD00003827 |
| InChI Key | UDIPTWFVPPPURJ-UHFFFAOYSA-M |
| Synonym | sodium cyclamate, sodium cyclohexylsulfamate, sodium n-cyclohexylsulfamate, cyclamate sodium, cyclamic acid sodium salt, assugrin, ibiosuc, suessette, suestamin, sugarin |
| PubChem CID | 23665706 |
| ChEBI | CHEBI:82431 |
| IUPAC Name | sodium;N-cyclohexylsulfamate |
| SMILES | [Na+].[O-]S(=O)(=O)NC1CCCCC1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC389280500
|
Thermo Scientific Chemicals
389280500 |
50 g | Plastic bottle |
Each for $63.82
|
|
||||
|
AC389282500
|
Thermo Scientific Chemicals
389282500 |
250 g | Plastic bottle |
Each for $157.04
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 139-05-9 | |
| 201.22 | |
| UDIPTWFVPPPURJ-UHFFFAOYSA-M | |
| 23665706 | |
| sodium;N-cyclohexylsulfamate |
| C6H12NNaO3S | |
| MFCD00003827 | |
| sodium cyclamate, sodium cyclohexylsulfamate, sodium n-cyclohexylsulfamate, cyclamate sodium, cyclamic acid sodium salt, assugrin, ibiosuc, suessette, suestamin, sugarin | |
| CHEBI:82431 | |
| [Na+].[O-]S(=O)(=O)NC1CCCCC1 |
Specifications
| 139-05-9 | |
| 5.5 to 7.5 (10% soln.) | |
| 1% max. | |
| 99% | |
| C6H12NNaO3S | |
| MFCD00003827 | |
| sodium cyclamate, sodium cyclohexylsulfamate, sodium n-cyclohexylsulfamate, cyclamate sodium, cyclamic acid sodium salt, assugrin, ibiosuc, suessette, suestamin, sugarin | |
| UDIPTWFVPPPURJ-UHFFFAOYSA-M | |
| sodium;N-cyclohexylsulfamate | |
| 23665706 | |
| 201.22 | |
| Powder |
| White | |
| >200°C | |
| Authentic | |
| Plastic bottle | |
| C6H12NNaO3S | |
| 50 g | |
| Solubility in water: 200g/L (20°C). Other solubilities: insoluble in ether and benzene | |
| [Na+].[O-]S(=O)(=O)NC1CCCCC1 | |
| 201.22 | |
| CHEBI:82431 | |
| 99% | |
| Sodium cyclamate |
Safety and Handling
GHS H Statement:
Harmful if swallowed.
GHS P Statement:
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
GHS Signal Word: Warning
EINECSNumber : 205-348-9
RUO – Research Use Only