missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Selectophore™ Magnesium Ionophore I, Function Tested, MilliporeSigma™ Supelco™
Magnesium ionophore I (ETH 1117) has been used to prepare calcium-magnesium selective electrode.
Supplier: Merck Emd Millipore 6308250MGF
Description
Neutral synthetic ionophore for Mg2+-selective microelectrodes.; The selectivities as compared to Na+, K+, Ca2+ are sufficient for intracellular measurement of magnesium ion activities: F. Lanter, D. Erne, D. Ammann, W. Simon; Magnesium-selective ionophore for solvent polymeric membrane electrodesSpecifications
| 75513-72-3 | |
| C20H40N2O2 | |
| MFCD00043110 | |
| ETH 1117; Magnesium-ligand; N,N'-Diheptyl-N,N'-dimethyl-1,4-butanediamide | |
| CCCCCCCN(C)C(=O)CCC(=O)N(C)CCCCCCC | |
| 340.55 | |
| Selectophore |
| Bottomless Glass Bottle with Fused Cone | |
| C20H40N2O2 | |
| 50 mg | |
| CBEVANLIGJVSHZ-UHFFFAOYSA-N | |
| N,N'-diheptyl-N,N'-dimethylbutanediamide | |
| 340.54 | |
| Selectophore |
Chemical Identifiers
| 75513-72-3 | |
| 340.55 | |
| CBEVANLIGJVSHZ-UHFFFAOYSA-N | |
| N,N'-diheptyl-N,N'-dimethylbutanediamide |
| C20H40N2O2 | |
| MFCD00043110 | |
| ETH 1117; Magnesium-ligand; N,N'-Diheptyl-N,N'-dimethyl-1,4-butanediamide | |
| CCCCCCCN(C)C(=O)CCC(=O)N(C)CCCCCCC |
Selectophore is a trademark of Sigma-Aldrich Chemie GmbH