missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Saquinavir mesylate, 98%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 461231000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Saquinavir mesylate | |
| 1% max. | |
| 97.5% min. (HPLC) | |
| 100mg | |
| IRHXGOXEBNJUSN-YOXDLBRISA-N | |
| (2S)-N-[(2S,3R)-4-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]-2-(quinoline-2-carbonylamino)butanediamide;methanesulfonic acid | |
| 60934 | |
| 766.95 |
| 149845-06-7 | |
| Authentic | |
| C38H50N6O5·CH4O3S | |
| saquinavir mesylate, invirase, fortovase, saquinavir mesilate, saquinavir, mesylate, unii-uhb9z3841a, saquinavir monomethanesulfonate salt, saquinavir mesylate aids initiative, invirase tn, dsstox_cid_3835 | |
| CC(C)(C)NC(=O)C1CC2CCCCC2CN1CC(C(CC3=CC=CC=C3)NC(=O)C(CC(=O)N)NC(=O)C4=NC5=CC=CC=C5C=C4)O.CS(=O)(=O)O | |
| 766.95 | |
| CHEBI:32121 | |
| 98% |
Chemical Identifiers
| 149845-06-7 | |
| 766.95 | |
| saquinavir mesylate, invirase, fortovase, saquinavir mesilate, saquinavir, mesylate, unii-uhb9z3841a, saquinavir monomethanesulfonate salt, saquinavir mesylate aids initiative, invirase tn, dsstox_cid_3835 | |
| CHEBI:32121 | |
| CC(C)(C)NC(=O)C1CC2CCCCC2CN1CC(C(CC3=CC=CC=C3)NC(=O)C(CC(=O)N)NC(=O)C4=NC5=CC=CC=C5C=C4)O.CS(=O)(=O)O |
| C38H50N6O5·CH4O3S | |
| IRHXGOXEBNJUSN-YOXDLBRISA-N | |
| 60934 | |
| (2S)-N-[(2S,3R)-4-[(3S,4aS,8aS)-3-(tert-butylcarbamoyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-hydroxy-1-phenylbutan-2-yl]-2-(quinoline-2-carbonylamino)butanediamide;methanesulfonic acid |
RUO â Research Use Only