missing translation for 'onlineSavingsMsg'
Learn More
Learn More
(S)-(+)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetyl chloride, 99%
CAS: 20445-33-4 | C10H8ClF3O2 | 252.62 g/mol
793,86 $ - 793,86 $
Identifiants chimiques
| CAS | 20445-33-4 |
|---|---|
| Molecular Formula | C10H8ClF3O2 |
| Molecular Weight (g/mol) | 252.62 |
| MDL Number | MFCD00067105 |
| InChI Key | PAORVUMOXXAMPL-SECBINFHSA-N |
| Synonym | s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, +-mtpa-cl, unii-472va70ul4, 2s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, s-+-alpha-methoxy-alpha-trifluoromethylphenylacetyl chloride, s-+-a-methoxy-a-trifluoromethylphenylacetyl chloride, s-+-alpha-methoxy-alpha-trifluoromethylphenylacetylchloride, s-+-alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, +-mtpa chloride, +-mosher's chloride |
| PubChem CID | 2724611 |
| IUPAC Name | (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
| SMILES | COC(C1=CC=CC=C1)(C(=O)Cl)C(F)(F)F |
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Packaging | Prix | Quantité | ||||
|---|---|---|---|---|---|---|---|---|---|
| Numéro de catalogue | Numéro du manufacturier. | Quantity | Packaging | Prix | Quantité | ||||
|
AC264110010
|
Thermo Scientific Chemicals
264110010 |
1 g | Glass bottle |
N/A
|
|
Connectez-vous ou enregistrez-vous pour vérifier votre prix et la disponibilité.
|
|||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chiral derivatization reagentIdentifiants chimiques
| 20445-33-4 | |
| 252.62 | |
| PAORVUMOXXAMPL-SECBINFHSA-N | |
| 2724611 | |
| COC(C1=CC=CC=C1)(C(=O)Cl)C(F)(F)F |
| C10H8ClF3O2 | |
| MFCD00067105 | |
| s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, +-mtpa-cl, unii-472va70ul4, 2s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, s-+-alpha-methoxy-alpha-trifluoromethylphenylacetyl chloride, s-+-a-methoxy-a-trifluoromethylphenylacetyl chloride, s-+-alpha-methoxy-alpha-trifluoromethylphenylacetylchloride, s-+-alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, +-mtpa chloride, +-mosher's chloride | |
| (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
Spécifications
| 20445-33-4 | |
| 100.0 | |
| 1.3400g/mL | |
| 89°C | |
| 98.5% min. (GC) | |
| C10H8ClF3O2 | |
| MFCD00067105 | |
| 1.34 | |
| +132° (20°C c=6,CHCl3) | |
| s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, +-mtpa-cl, unii-472va70ul4, 2s-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, s-+-alpha-methoxy-alpha-trifluoromethylphenylacetyl chloride, s-+-a-methoxy-a-trifluoromethylphenylacetyl chloride, s-+-alpha-methoxy-alpha-trifluoromethylphenylacetylchloride, s-+-alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, +-mtpa chloride, +-mosher's chloride | |
| COC(C1=CC=CC=C1)(C(=O)Cl)C(F)(F)F | |
| 252.62 | |
| 252.62 | |
| Liquid |
| 98.5 | |
| Colorless to Yellow | |
| 213.0°C to 214.0°C | |
| Authentic | |
| Glass bottle | |
| 1.4680 to 1.4700 | |
| 1 g | |
| 15, 6365 | |
| + 132.00 | |
| PAORVUMOXXAMPL-SECBINFHSA-N | |
| (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride | |
| 2724611 | |
| 99% | |
| (S)-(+)-α-Methoxy-α-(trifluoromethyl)phenylacetyl chloride |
Sécurité et manipulation
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with wat
GHS Signal Word: Danger
RUO – Research Use Only