missing translation for 'onlineSavingsMsg'
Learn More
Learn More
(R)-N-BOC-alpha-Ethylalanine, 98%, 98% ee
CAS: 123254-58-0 | C10H19NO4 | 217.27 g/mol
Supplier: Thermo Scientific Chemicals 441061000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 104°C to 112°C | |
| 98% ee | |
| 97.5 | |
| White to Yellow | |
| 98% | |
| Glass Bottle | |
| -12 | |
| SHZXLTCEPXVCSV-SNVBAGLBSA-N | |
| (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid | |
| 217.27 | |
| 217.27 | |
| Powder |
| (R)-N-BOC-α-Ethylalanine | |
| 123254-58-0 | |
| 100.0 | |
| Authentic | |
| C10H19NO4 | |
| MFCD12963786 | |
| boc-d-isovaline, r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid, r-2-tert-butoxycarbonylamino-2-methylbutanoic acid, boc-iso-valine, r-n-boc-a-ethylalanine, s-n-boc-a-ethylalanine, r-2-methyl-2-tert-butoxycarbonylamino butyric acid, 2r-2-tert-butoxycarbonylamino-2-methyl-butanoic acid, 2r-2-tert-butoxy carbonyl amino-2-methylbutanoic acid, 2r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid | |
| CCC(C)(NC(=O)OC(C)(C)C)C(O)=O | |
| 100 mg | |
| 14284791 | |
| 98%,98% ee |
Chemical Identifiers
| 123254-58-0 | |
| 217.27 | |
| SHZXLTCEPXVCSV-SNVBAGLBSA-N | |
| 14284791 | |
| CCC(C)(NC(=O)OC(C)(C)C)C(O)=O |
| C10H19NO4 | |
| MFCD12963786 | |
| boc-d-isovaline, r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid, r-2-tert-butoxycarbonylamino-2-methylbutanoic acid, boc-iso-valine, r-n-boc-a-ethylalanine, s-n-boc-a-ethylalanine, r-2-methyl-2-tert-butoxycarbonylamino butyric acid, 2r-2-tert-butoxycarbonylamino-2-methyl-butanoic acid, 2r-2-tert-butoxy carbonyl amino-2-methylbutanoic acid, 2r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid | |
| (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
RUO – Research Use Only