missing translation for 'onlineSavingsMsg'
Learn More
Learn More
(R)-N-BOC-alpha-Ethylalanine, 98%, 98% ee
CAS: 123254-58-0 | C10H19NO4 | 217.27 g/mol
$266.12 - $266.12
Chemical Identifiers
| CAS | 123254-58-0 |
|---|---|
| Molecular Formula | C10H19NO4 |
| Molecular Weight (g/mol) | 217.27 |
| MDL Number | MFCD12963786 |
| InChI Key | SHZXLTCEPXVCSV-SNVBAGLBSA-N |
| Synonym | boc-d-isovaline, r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid, r-2-tert-butoxycarbonylamino-2-methylbutanoic acid, boc-iso-valine, r-n-boc-a-ethylalanine, s-n-boc-a-ethylalanine, r-2-methyl-2-tert-butoxycarbonylamino butyric acid, 2r-2-tert-butoxycarbonylamino-2-methyl-butanoic acid, 2r-2-tert-butoxy carbonyl amino-2-methylbutanoic acid, 2r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid |
| PubChem CID | 14284791 |
| IUPAC Name | (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | CCC(C)(NC(=O)OC(C)(C)C)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC441061000
|
Thermo Scientific Chemicals
441061000 |
100 mg |
Each for $266.12
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 123254-58-0 | |
| 217.27 | |
| SHZXLTCEPXVCSV-SNVBAGLBSA-N | |
| 14284791 | |
| CCC(C)(NC(=O)OC(C)(C)C)C(O)=O |
| C10H19NO4 | |
| MFCD12963786 | |
| boc-d-isovaline, r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid, r-2-tert-butoxycarbonylamino-2-methylbutanoic acid, boc-iso-valine, r-n-boc-a-ethylalanine, s-n-boc-a-ethylalanine, r-2-methyl-2-tert-butoxycarbonylamino butyric acid, 2r-2-tert-butoxycarbonylamino-2-methyl-butanoic acid, 2r-2-tert-butoxy carbonyl amino-2-methylbutanoic acid, 2r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid | |
| (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
Specifications
| 104°C to 112°C | |
| 97.5 | |
| White to Yellow | |
| 98% | |
| Glass Bottle | |
| -12 | |
| SHZXLTCEPXVCSV-SNVBAGLBSA-N | |
| (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid | |
| 217.27 | |
| 217.27 | |
| Powder |
| 123254-58-0 | |
| 100.0 | |
| Authentic | |
| C10H19NO4 | |
| MFCD12963786 | |
| boc-d-isovaline, r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid, r-2-tert-butoxycarbonylamino-2-methylbutanoic acid, boc-iso-valine, r-n-boc-a-ethylalanine, s-n-boc-a-ethylalanine, r-2-methyl-2-tert-butoxycarbonylamino butyric acid, 2r-2-tert-butoxycarbonylamino-2-methyl-butanoic acid, 2r-2-tert-butoxy carbonyl amino-2-methylbutanoic acid, 2r-2-tert-butoxycarbonyl amino-2-methylbutanoic acid | |
| CCC(C)(NC(=O)OC(C)(C)C)C(O)=O | |
| 100 mg | |
| 14284791 | |
| 98%,98% ee | |
| (R)-N-BOC-α-Ethylalanine, 98% ee |
RUO – Research Use Only