missing translation for 'onlineSavingsMsg'
Learn More
Learn More
(R)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetyl Chloride, TCI America™
(ca. 18% in Dichloromethane, ca. 1.0mol/L) [for Determination of the optical purity of Alcohols and Amines]
Supplier: TCI America M22155G
Specifications
| (R)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetyl Chloride (ca. 18% in Dichloromethane, ca. | |
| Yellow | |
| MFCD00044400 | |
| 3265 | |
| PAORVUMOXXAMPL-VIFPVBQESA-N | |
| (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride | |
| 3080792 | |
| Liquid |
| 39637-99-5 | |
| C10H8ClF3O2 | |
| 5 g | |
| unii-81ut10uhv3, r---mtpa-cl, --alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, r---alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, r-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, 2r-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, r---a-methoxy-a-trifluoromethylphenylacetyl chloride, r---alpha-methoxy-alpha-trifluoromethylphenylacetyl chloride, --mtpa-cl, --mosher's acid chloride | |
| CO[C@](C(Cl)=O)(C1=CC=CC=C1)C(F)(F)F | |
| 252.62 | |
| 252.62 |
Chemical Identifiers
| 39637-99-5 | |
| 252.62 | |
| PAORVUMOXXAMPL-VIFPVBQESA-N | |
| 3080792 | |
| CO[C@](C(Cl)=O)(C1=CC=CC=C1)C(F)(F)F |
| C10H8ClF3O2 | |
| MFCD00044400 | |
| unii-81ut10uhv3, r---mtpa-cl, --alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, r---alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, r-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, 2r-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, r---a-methoxy-a-trifluoromethylphenylacetyl chloride, r---alpha-methoxy-alpha-trifluoromethylphenylacetyl chloride, --mtpa-cl, --mosher's acid chloride | |
| (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
Safety and Handling
TSCA : No
Recommended Storage : Refrigerator