Learn More
(R)-(-)-alpha-Methoxy-alpha-(trifluoromethyl)phenylacetyl chloride, 98+%
CAS: 39637-99-5 | C10H8ClF3O2 | 252.62 g/mol
$915.70 - $915.70
Chemical Identifiers
| CAS | 39637-99-5 |
|---|---|
| Molecular Formula | C10H8ClF3O2 |
| Molecular Weight (g/mol) | 252.62 |
| MDL Number | MFCD00044400 |
| InChI Key | PAORVUMOXXAMPL-VIFPVBQESA-N |
| Synonym | unii-81ut10uhv3, r---mtpa-cl, --alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, r---alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, r-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, 2r-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, r---a-methoxy-a-trifluoromethylphenylacetyl chloride, r---alpha-methoxy-alpha-trifluoromethylphenylacetyl chloride, --mtpa-cl, --mosher's acid chloride |
| PubChem CID | 3080792 |
| IUPAC Name | (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
| SMILES | CO[C@](C(Cl)=O)(C1=CC=CC=C1)C(F)(F)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC264120010
|
Thermo Scientific Chemicals
264120010 |
1 g | Glass bottle |
Each for $915.70
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chiral derivatization reagentChemical Identifiers
| 39637-99-5 | |
| 252.62 | |
| PAORVUMOXXAMPL-VIFPVBQESA-N | |
| 3080792 | |
| CO[C@](C(Cl)=O)(C1=CC=CC=C1)C(F)(F)F |
| C10H8ClF3O2 | |
| MFCD00044400 | |
| unii-81ut10uhv3, r---mtpa-cl, --alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, r---alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, r-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, 2r-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, r---a-methoxy-a-trifluoromethylphenylacetyl chloride, r---alpha-methoxy-alpha-trifluoromethylphenylacetyl chloride, --mtpa-cl, --mosher's acid chloride | |
| (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride |
Specifications
| 39637-99-5 | |
| 100.0 | |
| 1.3400g/mL | |
| 89°C | |
| 98% min. (GC) | |
| C10H8ClF3O2 | |
| MFCD00044400 | |
| 1.34 | |
| −132.00 (20.00°C c=6,CHCl3) | |
| unii-81ut10uhv3, r---mtpa-cl, --alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, r---alpha-methoxy-alpha-trifluoromethyl phenylacetyl chloride, r-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, 2r-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride, r---a-methoxy-a-trifluoromethylphenylacetyl chloride, r---alpha-methoxy-alpha-trifluoromethylphenylacetyl chloride, --mtpa-cl, --mosher's acid chloride | |
| CO[C@](C(Cl)=O)(C1=CC=CC=C1)C(F)(F)F | |
| 252.62 | |
| 252.62 | |
| Liquid |
| 98.5 | |
| Colorless to Yellow | |
| 213.0°C to 214.0°C | |
| Authentic | |
| Glass bottle | |
| 1.4680 to 1.4700 | |
| 1 g | |
| 15, 6365 | |
| − 132.00 | |
| PAORVUMOXXAMPL-VIFPVBQESA-N | |
| (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl chloride | |
| 3080792 | |
| 98+% | |
| (R)-(-)-α-Methoxy-α-(trifluoromethyl)phenylacetyl chloride |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
RUO – Research Use Only