missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Pyrocatechol Violet Indicator, For Metal Titration, Honeywell Fluka™
Indicator for metal titration
Supplier: Honeywell Chemicals 326725G
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| Pyrocatechol Violet | |
| 115-41-3 | |
| MFCD00005868 | |
| 353938 | |
| RRRCKIRSVQAAAS-UHFFFAOYSA-N | |
| 4-[3-(3,4-dihydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]benzene-1,2-diol | |
| 66993 | |
| Glass Bottle | |
| 6.5 to 8 | |
| Powder |
| 185°C | |
| C19H14O7S | |
| NONH for all modes of transport | |
| Catechol violet | |
| OC1=CC=C(C=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(O)=C1 | |
| 386.37 | |
| 386.38g/mol | |
| For metal titration | |
| 5 g |
Chemical Identifiers
| 115-41-3 | |
| 386.37 | |
| RRRCKIRSVQAAAS-UHFFFAOYSA-N | |
| 66993 | |
| OC1=CC=C(C=C1O)C1(OS(=O)(=O)C2=CC=CC=C12)C1=CC=C(O)C(O)=C1 |
| C19H14O7S | |
| MFCD00005868 | |
| Catechol violet | |
| 4-[3-(3,4-dihydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]benzene-1,2-diol |
Safety and Handling
EINECSNumber : 204-088-3