Learn More
Pyrimethamine, 98%, Thermo Scientific Chemicals
$65.93 - $65.93
Chemical Identifiers
| CAS | 58-14-0 |
|---|---|
| Molecular Formula | C12H13ClN4 |
| Molecular Weight (g/mol) | 248.71 |
| MDL Number | MFCD00057350 |
| InChI Key | WKSAUQYGYAYLPV-UHFFFAOYSA-N |
| Synonym | pyrimethamine, chloridine, daraprim, chloridin, diaminopyritamin, 5-4-chlorophenyl-6-ethylpyrimidine-2,4-diamine, ethylpyrimidine, pirimetamina, chloridyn, malocide |
| PubChem CID | 4993 |
| ChEBI | CHEBI:8673 |
| IUPAC Name | 5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine |
| SMILES | CCC1=NC(N)=NC(N)=C1C1=CC=C(Cl)C=C1 |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC461200010
|
Thermo Scientific Chemicals
461200010 |
1 g |
Each for $65.93
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 58-14-0 | |
| 248.71 | |
| WKSAUQYGYAYLPV-UHFFFAOYSA-N | |
| 4993 | |
| 5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine |
| C12H13ClN4 | |
| MFCD00057350 | |
| pyrimethamine, chloridine, daraprim, chloridin, diaminopyritamin, 5-4-chlorophenyl-6-ethylpyrimidine-2,4-diamine, ethylpyrimidine, pirimetamina, chloridyn, malocide | |
| CHEBI:8673 | |
| CCC1=NC(N)=NC(N)=C1C1=CC=C(Cl)C=C1 |
Specifications
| 58-14-0 | |
| 0.5% max. (105°C, 4 h) | |
| 97.5% min. (HPLC) | |
| C12H13ClN4 | |
| 1 g | |
| Solubility in water: insoluble. | |
| CCC1=NC(N)=NC(N)=C1C1=CC=C(Cl)C=C1 | |
| 248.71 | |
| CHEBI:8673 | |
| 98% |
| 241.0°C | |
| Authentic | |
| Glass Bottle | |
| MFCD00057350 | |
| pyrimethamine, chloridine, daraprim, chloridin, diaminopyritamin, 5-4-chlorophenyl-6-ethylpyrimidine-2,4-diamine, ethylpyrimidine, pirimetamina, chloridyn, malocide | |
| WKSAUQYGYAYLPV-UHFFFAOYSA-N | |
| 5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine | |
| 4993 | |
| 248.71 | |
| Pyrimethamine |
Safety and Handling
GHS H Statement Harmful if swallowed. Suspected of damaging fertility or the unborn child.
GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Call a POISON CENTER or doctor/physician if you feel unwell. Wash face, hands and any exposed skin thoroughly after handling. Obtain special instructions before use. Wear protective gloves/protective clothing/eye protection/face protection.
GHS Signal Word: Warning
EINECSNumber : 200-364-2
RUO – Research Use Only