missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Pyrene, 98%
CAS: 129-00-0 | C16H10 | 202.25 g/mol
$61.89 - $171.13
Chemical Identifiers
| CAS | 129-00-0 |
|---|---|
| Molecular Formula | C16H10 |
| Molecular Weight (g/mol) | 202.25 |
| MDL Number | MFCD00004136 |
| InChI Key | BBEAQIROQSPTKN-UHFFFAOYSA-N |
| Synonym | benzo def phenanthrene, pyren, beta-pyrene, .beta.-pyrene, pyren german, unii-9e0t7wfw93, ccris 1256, pyrene def phenanthrene, coal tar pitch volatiles:pyrene |
| PubChem CID | 31423 |
| ChEBI | CHEBI:39106 |
| IUPAC Name | pyrene |
| SMILES | C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC180830250
|
Thermo Scientific Chemicals
180830250 |
25 g | Glass bottle |
Each for $61.89
|
|
||||
|
AC180831000
|
Thermo Scientific Chemicals
180831000 |
100 g | Glass bottle |
Each for $171.13
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 129-00-0 | |
| 202.25 | |
| BBEAQIROQSPTKN-UHFFFAOYSA-N | |
| 31423 | |
| pyrene |
| C16H10 | |
| MFCD00004136 | |
| benzo def phenanthrene, pyren, beta-pyrene, .beta.-pyrene, pyren german, unii-9e0t7wfw93, ccris 1256, pyrene def phenanthrene, coal tar pitch volatiles:pyrene | |
| CHEBI:39106 | |
| C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 |
Specifications
| 129-00-0 | |
| Green-Yellow to Yellow | |
| 210°C | |
| 97.5% min. (GC) | |
| C16H10 | |
| 25 g | |
| 04,414 | |
| benzo def phenanthrene, pyren, beta-pyrene, .beta.-pyrene, pyren german, unii-9e0t7wfw93, ccris 1256, pyrene def phenanthrene, coal tar pitch volatiles:pyrene | |
| BBEAQIROQSPTKN-UHFFFAOYSA-N | |
| pyrene | |
| 31423 | |
| 202.25 | |
| Crystals and/or Chunks |
| 148°C to 152°C | |
| 393°C | |
| Authentic | |
| Glass bottle | |
| MFCD00004136 | |
| 05,693 | |
| 15,8074 | |
| Solubility in water: almost insoluble. Other solubilities: soluble in ethanol,ether,benzene and toluene,slightly soluble in carbon tetrachloride | |
| C1=CC2=C3C(=C1)C=CC4=CC=CC(=C43)C=C2 | |
| 202.25 | |
| CHEBI:39106 | |
| 98% | |
| Pyrene |
Safety and Handling
GHS H Statement
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Avoid release to the environment.
GHS Signal Word: Warning
EINECSNumber : 204-927-3
RUO – Research Use Only