missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Persulfate (Certified ACS), Fisher Chemical™
Supplier: Thermo Fisher Scientific P282100
Specifications
| Potassium Persulfate | |
| 7727-21-1 | |
| 4 to 5 | |
| 100 g | |
| K2O8S2 | |
| 1492 | |
| USHAGKDGDHPEEY-UHFFFAOYSA-L | |
| dipotassium;sulfonatooxy sulfate | |
| 24412 | |
| ≥99% | |
| Pass Test |
| 100°C | |
| White | |
| Solid | |
| ≥99 % | |
| MFCD00011386 | |
| potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc | |
| [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] | |
| 270.309 | |
| 270.32 | |
| Certified ACS | |
| Poly Bottle |
Chemical Identifiers
| 7727-21-1 | |
| 270.309 | |
| USHAGKDGDHPEEY-UHFFFAOYSA-L | |
| 24412 | |
| [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] |
| K2O8S2 | |
| MFCD00011386 | |
| potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc | |
| dipotassium;sulfonatooxy sulfate |
Safety and Handling
DANGER!
Emergency Overview
Oxidizer: Contact with combustible/organic material may cause fire. Irritating to eyes, respiratory system and skin. May cause allergic respiratory and skin reaction. Hygroscopic. Use personal protective equipment. Keep away from clothing and other combustible materials. Use only under a chemical fume hood. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. Move to fresh air. If breathing is difficult, give oxygen.
NFPA
Health:2
Flammability:0
Instability:2
DOTInformation : DOT Class 5.1, : Oxidizer