missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Persulfate (Certified ACS), Fisher Chemical™
$266.50 - $738.42
Chemical Identifiers
| CAS | 7727-21-1 |
|---|---|
| Molecular Formula | K2O8S2 |
| Molecular Weight (g/mol) | 270.309 |
| MDL Number | MFCD00011386 |
| InChI Key | USHAGKDGDHPEEY-UHFFFAOYSA-L |
| Synonym | potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc |
| PubChem CID | 24412 |
| IUPAC Name | dipotassium;sulfonatooxy sulfate |
| SMILES | [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
P282-100
|
Fisher Chemical
P282100 |
100 g | Poly Bottle |
Each for $266.50
Case of 6 Each for $1,599.00
|
|
||||
|
P282-500
|
Thermo Fisher Scientific
P282500 |
500 g | Poly Bottle |
Each for $738.42
Case of 6 Each for $4,430.52
|
|
||||
Chemical Identifiers
| 7727-21-1 | |
| 270.309 | |
| USHAGKDGDHPEEY-UHFFFAOYSA-L | |
| 24412 | |
| [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] |
| K2O8S2 | |
| MFCD00011386 | |
| potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc | |
| dipotassium;sulfonatooxy sulfate |
Specifications
| 100°C | |
| White | |
| Solid | |
| ≥99 % | |
| MFCD00011386 | |
| potassium persulfate, anthion, potassium peroxydisulfate, potassium peroxodisulfate, dipotassium peroxydisulfate, potassium peroxydisulphate, dipotassium persulfate, caswell no. 700, dipotassium peroxodisulphate, unii-6b86k0mczc | |
| [O-]S(=O)(=O)OOS(=O)(=O)[O-].[K+].[K+] | |
| 270.309 | |
| 270.32 | |
| Certified ACS | |
| Poly Bottle |
| 7727-21-1 | |
| 4 to 5 | |
| 100 g | |
| K2O8S2 | |
| 1492 | |
| USHAGKDGDHPEEY-UHFFFAOYSA-L | |
| dipotassium;sulfonatooxy sulfate | |
| 24412 | |
| ≥99% | |
| Pass Test | |
| Potassium Persulfate |
Safety and Handling
DANGER!
Emergency Overview
Oxidizer: Contact with combustible/organic material may cause fire. Irritating to eyes, respiratory system and skin. May cause allergic respiratory and skin reaction. Hygroscopic. Use personal protective equipment. Keep away from clothing and other combustible materials. Use only under a chemical fume hood. Wash off immediately with plenty of water for at least 15 minutes. Obtain medical attention. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. Move to fresh air. If breathing is difficult, give oxygen.
NFPA
Health:2
Flammability:0
Instability:2
DOTInformation : DOT Class 5.1, : Oxidizer