missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Dichromate Solution, 1/6 M, Honeywell™
Volumetric, 1/6Â M K2Cr2O7 (1N)
Supplier: Honeywell Chemicals 342711L
Description
Honeywell´s high-quality titration products cover the complete titration workflow and include:
- Solutions for volumetric titration (acids, bases, or salts)
- Buffers available as concentrates or ready-to-use
- Reagents for complexometry:
- Aminopolycarboxylic acids (EDTA/NTA analogs)
- Masking agents
- Indicators for volumetric and complexometric titrations
Specifications
| Potassium dichromate solution | |
| 1 L | |
| K2Cr2O7 | |
| UN3287 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24502 | |
| 294.18g/mol |
| 7778-50-9 | |
| Cr2K2O7 | |
| MFCD00011367 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 |
Chemical Identifiers
| 7778-50-9 | |
| 294.182 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| Cr2K2O7 | |
| MFCD00011367 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
Safety and Handling
P201-P260-P280-P284-P305 + P351 + P338-P308 + P313