missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium dichromate, Puriss. p.a., ACS Reagent, Reag. ISO, Reag. Ph. Eur., ≥99.8%, Honeywell Fluka™
Puriss. p.a., ACS Reagent, Reag. ISO, Reag. Ph. Eur.,≥99.8%
$373.98 - $853.73
Chemical Identifiers
| CAS | 7778-50-9 |
|---|---|
| Molecular Formula | Cr2K2O7 |
| Molecular Weight (g/mol) | 294.182 |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Synonym | potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash |
| PubChem CID | 24502 |
| ChEBI | CHEBI:53444 |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Chemical Identifiers
| 7778-50-9 | |
| 294.182 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
Specifications
| 7778-50-9 | |
| Cr2K2O7 | |
| MFCD00011367 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| ≥99.8% | |
| Potassium Dichromate, Reag. Ph. Eur. reag. ISO |
| 250 g | |
| K2Cr2O7 | |
| 3086 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24502 | |
| 294.18g/mol | |
| ACS/puriss. p.a. |
Safety and Handling
P201-P280-P304 + P340 + P310-P305 + P351 + P338-P308 + P313
H272-H301-H312-H314-H317-H330-H334-H340-H350-H360FD-H372-H410
EINECSNumber : 231-906-6
RTECSNumber : HX7680000