missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium dichromate concentrate, For 1L standard solution, 1/60Â M K2Cr2O7 (0.1N), Honeywell Fluka™
for 1L standard solution, 1/60Â M K2Cr2O7 (0.1N)
$228.40 - $1169.28
Chemical Identifiers
| CAS | 7778-50-9 |
|---|---|
| Molecular Formula | Cr2K2O7 |
| Molecular Weight (g/mol) | 294.182 |
| MDL Number | MFCD00011367 |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Synonym | potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash |
| PubChem CID | 24502 |
| ChEBI | CHEBI:53444 |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Chemical Identifiers
| 7778-50-9 | |
| 294.182 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| Cr2K2O7 | |
| MFCD00011367 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
Specifications
| 7778-50-9 | |
| Cr2K2O7 | |
| MFCD00011367 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| Ampoule |
| 1 Pc. | |
| K2Cr2O7 | |
| UN3082 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24502 | |
| 294.18g/mol | |
| Potassium dichromate concentrate |
Safety and Handling
P201-P260-P280-P284-P305 + P351 + P338-P308 + P313