missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Dichromate, ACS Reagent Grade, Ricca Chemical
Supplier: Ricca Chemical Company RDCP042012F4
Specifications
| Potassium Dichromate | |
| 98.0 | |
| 12 kg | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| Fiber Drum |
| 7778-50-9 | |
| 100.0 | |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24502 | |
| ACS |
Safety and Handling
ShelfLife : 60 months