missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Dichromate, ACS Reagent Grade, Ricca Chemical
$608.07 - $608.07
Chemical Identifiers
| CAS | 7778-50-9 |
|---|---|
| Molecular Formula | Cr2K2O7 |
| Molecular Weight (g/mol) | 294.182 |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Synonym | potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash |
| PubChem CID | 24502 |
| ChEBI | CHEBI:53444 |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
RDCP0420500
|
Ricca Chemical Company
RDCP0420500B1 |
500 g | White Poly Wide Mouth Bottle |
Each for $608.07
|
|
||||
Chemical Identifiers
| 7778-50-9 | |
| 294.182 | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| CHEBI:53444 | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| 24502 | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
Specifications
| Orange-Red | |
| 98.0 | |
| Powder | |
| Cr2K2O7 | |
| KMUONIBRACKNSN-UHFFFAOYSA-N | |
| dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium | |
| 24502 | |
| ≥ 99% | |
| White Poly Wide Mouth Bottle |
| 7778-50-9 | |
| 100.0 | |
| 500 g | |
| potassium dichromate, potassium bichromate, kaliumdichromat, iopezite, dipotassium bichromate, dipotassium dichromate, potassium dichromate vi, dichromic acid dipotassium salt, dipotassium dichromium heptaoxide, bichromate of potash | |
| [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] | |
| 294.182 | |
| CHEBI:53444 | |
| ACS | |
| Potassium Dichromate |
Safety and Handling
ShelfLife : 60 months