missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Biiodate, Certified, 0.0375N ±0.0005N (0.00313M), LabChem™
$111.43 - $169.39
Chemical Identifiers
| CAS | 13455-24-8 |
|---|---|
| Molecular Formula | HI2KO6 |
| Molecular Weight (g/mol) | 389.909 |
| InChI Key | ACAYDTMSDROWHW-UHFFFAOYSA-M |
| Synonym | potassium hydrogen diiodate, potassium biiodate, kaliumhydrogendijodat, iodic acid hio3 , potassium salt 2:1, potassium biiodate solution, potassium iodic acid iodate, io3.k.hio3, potassium ion iodic acid iodate, potassium hydrogen iodate powder, potassium hydrogen diiodate, p.a |
| PubChem CID | 23700942 |
| IUPAC Name | potassium;iodic acid;iodate |
| SMILES | OI(=O)=O.[O-]I(=O)=O.[K+] |
Chemical Identifiers
| 13455-24-8 | |
| 389.909 | |
| potassium hydrogen diiodate, potassium biiodate, kaliumhydrogendijodat, iodic acid hio3 , potassium salt 2:1, potassium biiodate solution, potassium iodic acid iodate, io3.k.hio3, potassium ion iodic acid iodate, potassium hydrogen iodate powder, potassium hydrogen diiodate, p.a | |
| potassium;iodic acid;iodate |
| HI2KO6 | |
| ACAYDTMSDROWHW-UHFFFAOYSA-M | |
| 23700942 | |
| OI(=O)=O.[O-]I(=O)=O.[K+] |
Specifications
| 13455-24-8,7732-18-5 | |
| 99.88,0.12 | |
| 500 mL | |
| KHI2O6 | |
| Soluble in water | |
| OI(=O)=O.[O-]I(=O)=O.[K+] | |
| 389.909 | |
| 389.92 | |
| 0.0375N ±0.0005N (0.00313M) | |
| Poly Bottle | |
| Iodine vapor | |
| Potassium Biiodate |
| Colorless | |
| Liquid | |
| HI2KO6 | |
| potassium hydrogen diiodate, potassium biiodate, kaliumhydrogendijodat, iodic acid hio3 , potassium salt 2:1, potassium biiodate solution, potassium iodic acid iodate, io3.k.hio3, potassium ion iodic acid iodate, potassium hydrogen iodate powder, potassium hydrogen diiodate, p.a | |
| ACAYDTMSDROWHW-UHFFFAOYSA-M | |
| potassium;iodic acid;iodate | |
| 23700942 | |
| Certified | |
| Passes Test | |
| 1g/mL | |
| 1g/mL |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature