missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Potassium Acid Phthalate, Certified, 0.0500N ±0.0005N (0.05M), LabChem™
$104.97 - $166.63
Chemical Identifiers
| CAS | 877-24-7 |
|---|---|
| Molecular Formula | C8H5KO4 |
| Molecular Weight (g/mol) | 204.222 |
| InChI Key | IWZKICVEHNUQTL-UHFFFAOYSA-M |
| Synonym | potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic |
| PubChem CID | 23676735 |
| IUPAC Name | potassium;2-carboxybenzoate |
| SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
Chemical Identifiers
| 877-24-7 | |
| 204.222 | |
| potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic | |
| potassium;2-carboxybenzoate |
| C8H5KO4 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
Specifications
| 877-24-7,7732-18-5 | |
| Carbon monoxide; Carbon dioxide | |
| 1g/mL | |
| C8H5KO4 | |
| 500 mL | |
| potassium hydrogen phthalate, potassium biphthalate, monopotassium phthalate, potassium acid phthalate, hydrogen potassium phthalate, phthalic acid monopotassium salt, 1,2-benzenedicarboxylic acid, monopotassium salt, phthalic acid, monopotassium salt, phthalic acid potassium salt, potassium phthalate monobasic | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 23676735 | |
| Certified | |
| Liquid |
| 98.98,1.02 | |
| Colorless | |
| Poly Bottle | |
| KHC8H4O4 | |
| 1g/mL | |
| Soluble in water | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.222 | |
| 204.23 | |
| 0.0500N ±0.0005N (0.05M) | |
| Potassium Acid Phthalate |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature