Learn More
Polysorbate 80, FCC, 65-69.5%, Spectrum™ Chemical
P1179, 9005-65-6
Supplier: Spectrum Chemical Mfg Cor P117920LT
Description
Spectrum™ Chemical Polysorbate 80, FCC is used as a wetting agent. The FCC grade meets the requirements of the Food Chemical Codex indicates and is suitable for all food, beverage and nutritional supplement applications. Spectrum Chemical offers over 300 Food grade chemical ingredients packaged in laboratory size bottles to production drum quantities and are manufactured, packaged and stored under current Good Manufacturing Practices (cGMP) per 21CFR part 211 in FDA registered and inspected facilities.
Specifications
| Polysorbate 80 | |
| 9005-65-6 | |
| Neutral | |
| 65 -80 | |
| Amber Glass Bottle | |
| (C2H4O)x(C2H4O)z(C2H4O)y(C2H4O)wC24H44O6 | |
| MFCD00082107 | |
| CCCCCCCC\C=C/CCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO | |
| 604.82 | |
| FCC |
| 2 | |
| 1 | |
| 20 L | |
| 0.0025 | |
| 45-55 | |
| 0.03 | |
| HDTIFOGXOGLRCB-KTKRTIGZNA-N | |
| 2-{2-[3,5-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy}ethyl (9E)-octadec-9-enoate | |
| 65 to 69.5% |
Chemical Identifiers
| 9005-65-6 | |
| 604.82 | |
| HDTIFOGXOGLRCB-KTKRTIGZNA-N | |
| CCCCCCCC\C=C/CCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO |
| (C2H4O)x(C2H4O)z(C2H4O)y(C2H4O)wC24H44O6 | |
| MFCD00082107 | |
| 2-{2-[3,5-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy}ethyl (9E)-octadec-9-enoate |