missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Polygalacturonic acid, >86%, MP Biomedicals™
Manufacturer: MP Biochemicals LLC 0210271125
Specifications
| Polygalacturonic acid | |
| 25g | |
| 25990-10-7 | |
| C6H10O7 | |
| alpha-d-galactopyranuronic acid | |
| C1(C(C(OC(C1O)O)C(=O)O)O)O | |
| 194.139 | |
| CHEBI:33885 | |
| Crystalline Powder |
| Tan to White | |
| from Pectin | |
| >86% | |
| MFCD00131972 | |
| AEMOLEFTQBMNLQ-BKBMJHBISA-N | |
| (2S,3R,4S,5R,6S)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid | |
| 445929 | |
| (176)n n=150 to 400 | |
| 88.7% |
Chemical Identifiers
| 25990-10-7 | |
| 194.139 | |
| AEMOLEFTQBMNLQ-BKBMJHBISA-N | |
| 445929 | |
| (2S,3R,4S,5R,6S)-3,4,5,6-tetrahydroxyoxane-2-carboxylic acid |
| C6H10O7 | |
| MFCD00131972 | |
| alpha-d-galactopyranuronic acid | |
| CHEBI:33885 | |
| C1(C(C(OC(C1O)O)C(=O)O)O)O |
Safety and Handling
Recommended Storage : Store at Room Temperature (15 to 30°C).