missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phytyl Acetate (cis- and trans- mixture) 88.0+%, TCI America™
Supplier: TCI America P16755G
Specifications
| Phytyl Acetate (cis- and trans- mixture) | |
| Yellow | |
| MFCD00673238 | |
| Acetic Acid 3,7,11,15-Tetramethyl-2-hexadecenyl Ester, 3,7,11,15-Tetramethyl-2-hexadecenyl Acetate | |
| CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC\C(C)=C\COC(C)=O | |
| 338.58 | |
| 338.58 | |
| Liquid |
| 10236-16-5 | |
| C22H42O2 | |
| 5 g | |
| JIGCTXHIECXYRJ-ILWBRPEASA-N | |
| (2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl acetate | |
| 53425386 | |
| ≥88.0% (GC) |
Chemical Identifiers
| 10236-16-5 | |
| 338.58 | |
| JIGCTXHIECXYRJ-ILWBRPEASA-N | |
| 53425386 | |
| CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC\C(C)=C\COC(C)=O |
| C22H42O2 | |
| MFCD00673238 | |
| Acetic Acid 3,7,11,15-Tetramethyl-2-hexadecenyl Ester, 3,7,11,15-Tetramethyl-2-hexadecenyl Acetate | |
| (2E,7R,11R)-3,7,11,15-tetramethylhexadec-2-en-1-yl acetate |
Safety and Handling
RTECSNumber : MM0675000
TSCA : Yes