Learn More
Phenyltrimethoxysilane, 85%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 370640500
| Quantity | 50mL |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| C9H14O3Si | |
| MFCD00025689 | |
| phenyltrimethoxysilane, trimethoxy phenyl silane, silane, trimethoxyphenyl, silane, phenyltrimethoxy, unii-21tqe746s9, trimethoxysilyl benzene, benzene, trimethoxysilyl, phenyl trimethoxysilane, phenyl trimethoxy silane, phenyltri methoxy silane | |
| trimethoxy(phenyl)silane |
Specifications
| Phenyltrimethoxysilane | |
| 1.0620g/mL | |
| 50°C | |
| 80% min. (GC) | |
| C9H14O3Si | |
| C6H5Si(OCH3)3 | |
| MFCD00025689 | |
| 1.062 | |
| Solubility in water: soluble | |
| CO[Si](OC)(OC)C1=CC=CC=C1 | |
| 198.29 | |
| 198.29 |
| 2996-92-1 | |
| 233°C | |
| Authentic | |
| Glass bottle | |
| 1.4730 to 1.475 | |
| 50mL | |
| 16, IV, 1556 | |
| phenyltrimethoxysilane, trimethoxy phenyl silane, silane, trimethoxyphenyl, silane, phenyltrimethoxy, unii-21tqe746s9, trimethoxysilyl benzene, benzene, trimethoxysilyl, phenyl trimethoxysilane, phenyl trimethoxy silane, phenyltri methoxy silane | |
| ZNOCGWVLWPVKAO-UHFFFAOYSA-N | |
| trimethoxy(phenyl)silane | |
| 18137 | |
| 85% |
Safety and Handling
GHS H Statement
Flammable liquid and vapor.
Harmful if swallowed.
May cause damage to organs through prolonged or repeated exposure if swallowed.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with water/shower.
IF SWALLOWED: rinse mouth.
Do NOT induce vomi
GHS Signal Word: Warning
EINECSNumber : 221-066-9