missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phenyl sulfoxide, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 130971000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Phenyl sulfoxide | |
| 945-51-7 | |
| Authentic | |
| Glass bottle | |
| (C6H5)2SO | |
| 100g | |
| 01,348; 17,365 | |
| JJHHIJFTHRNPIK-UHFFFAOYSA-N | |
| benzenesulfinylbenzene | |
| 13679 | |
| 97% |
| 97% | |
| 206.0°C to 208.0°C (13.0mmHg) | |
| 96% min. (HPLC) | |
| C12H10OS | |
| MFCD00002085 | |
| 06, 300 | |
| diphenyl sulfoxide, phenyl sulfoxide, sulfinyldibenzene, phenylsulfinylbenzene, diphenyl sulphoxide, sulfoxide, diphenyl, diphenylsulfoxide, benzene, 1,1'-sulfinylbis, 1,1'-sulfinyldibenzene, phenylsulfinyl benzene | |
| C1=CC=C(C=C1)S(=O)C2=CC=CC=C2 | |
| 202.27 | |
| 202.27 |
Chemical Identifiers
| 945-51-7 | |
| 202.27 | |
| JJHHIJFTHRNPIK-UHFFFAOYSA-N | |
| 13679 | |
| C1=CC=C(C=C1)S(=O)C2=CC=CC=C2 |
| C12H10OS | |
| MFCD00002085 | |
| diphenyl sulfoxide, phenyl sulfoxide, sulfinyldibenzene, phenylsulfinylbenzene, diphenyl sulphoxide, sulfoxide, diphenyl, diphenylsulfoxide, benzene, 1,1'-sulfinylbis, 1,1'-sulfinyldibenzene, phenylsulfinyl benzene | |
| benzenesulfinylbenzene |
Safety and Handling
EINECSNumber : 213-415-9
RTECSNumber : DA9185000
TSCA : TSCA
RUO â Research Use Only