missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Phenolphthalein Solution, Alcoholic, 1.0%, Fisher Chemical™
Volumetric indicator
Supplier: Thermo Fisher Scientific FLSP62500
| Quantity | 500 mL |
|---|---|
| Packaging | Glass Bottle |
Chemical Identifiers
| 77-09-8 , 67-63-0 | |
| 318.33 | |
| KJFMBFZCATUALV-UHFFFAOYSA-N | |
| CHEBI:34914 | |
| OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 |
| C20H14O4 | |
| MFCD00005913 | |
| 4764 | |
| 3,3-bis(4-hydroxyphenyl)-1,3-dihydro-2-benzofuran-1-one |
Specifications
| Phenolphthalein Solution, Alcoholic 1.0% | |
| 83°C | |
| 0.7 to 1.3% | |
| MFCD00005913 | |
| OC1=CC=C(C=C1)C1(OC(=O)C2=CC=CC=C12)C1=CC=C(O)C=C1 | |
| 318.33 | |
| CHEBI:34914 | |
| Glass Bottle | |
| Pass Test | |
| Colorless | |
| Liquid |
Safety and Handling
DOTInformation : DOT Class 3, : Flammable Liquid